CymitQuimica logo

CAS 61152-63-4

:

3a,4,7,7a-Tetrahydro-2-(phenylamino)-1H-isoindole-1,3(2H)-dione

Description:
3a,4,7,7a-Tetrahydro-2-(phenylamino)-1H-isoindole-1,3(2H)-dione, with the CAS number 61152-63-4, is a chemical compound characterized by its isoindole structure, which features a bicyclic framework. This compound contains a phenylamino group, contributing to its potential biological activity. The presence of the dione functional groups indicates that it has two carbonyl (C=O) functionalities, which can participate in various chemical reactions, including nucleophilic attacks and hydrogen bonding. The tetrahydro configuration suggests that the compound is saturated in certain positions, which may influence its reactivity and stability. This compound is of interest in medicinal chemistry due to its structural features that may exhibit pharmacological properties. Its solubility, melting point, and specific reactivity would depend on the surrounding conditions and the presence of other functional groups. Overall, 3a,4,7,7a-Tetrahydro-2-(phenylamino)-1H-isoindole-1,3(2H)-dione represents a unique scaffold that could be explored for various applications in drug development and organic synthesis.
Formula:C14H14N2O2
InChI:InChI=1S/C14H14N2O2/c17-13-11-8-4-5-9-12(11)14(18)16(13)15-10-6-2-1-3-7-10/h1-7,11-12,15H,8-9H2
InChI key:InChIKey=IVHYKVOJOGRKBX-UHFFFAOYSA-N
SMILES:O=C1C2C(C(=O)N1NC3=CC=CC=C3)CC=CC2
Synonyms:
  • 2-Anilino-3a,4,7,7a-tetrahydroisoindole-1,3-dione
  • 3a,4,7,7a-Tetrahydro-2-(phenylamino)-1H-isoindole-1,3(2H)-dione
  • 1H-Isoindole-1,3(2H)-dione, 3a,4,7,7a-tetrahydro-2-(phenylamino)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.