CAS 61153-76-2
:1-(2,4-Dihydroxyphenyl)-3-(4-hydroxyphenyl)-1,3-propanedione
Description:
1-(2,4-Dihydroxyphenyl)-3-(4-hydroxyphenyl)-1,3-propanedione, also known as a type of flavonoid compound, is characterized by its structural features, which include two hydroxyl groups on the phenyl rings and a diketone moiety. This compound typically exhibits antioxidant properties due to the presence of multiple hydroxyl groups, which can donate hydrogen atoms and neutralize free radicals. It is often studied for its potential biological activities, including anti-inflammatory and anticancer effects. The compound is soluble in organic solvents and may have limited solubility in water, which is common for many flavonoids. Its molecular structure allows for various interactions with biological macromolecules, making it of interest in pharmacological research. Additionally, the presence of multiple functional groups contributes to its reactivity and potential applications in medicinal chemistry and natural product synthesis. Overall, this compound represents a significant area of study in the field of natural products and medicinal chemistry due to its diverse biological activities.
Formula:C15H12O5
InChI:InChI=1/C15H12O5/c16-10-3-1-9(2-4-10)13(18)8-15(20)12-6-5-11(17)7-14(12)19/h1-7,16-17,19H,8H2
InChI key:InChIKey=QIEKMEBGIJSGGB-UHFFFAOYSA-N
SMILES:C(CC(=O)C1=CC=C(O)C=C1)(=O)C2=C(O)C=C(O)C=C2
Synonyms:- 1,3-Propanedione, 1-(2,4-dihydroxyphenyl)-3-(4-hydroxyphenyl)-
- 1-(2,4-Dihydroxyphenyl)-3-(4-hydroxyphenyl)-1,3-propanedione
- Licodione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Licodione
CAS:Licodione is a Cytochrome P450 Monooxygenase Catalyzing 2-Hydroxylation of 5-Deoxyflavanone.Formula:C15H12O5Color and Shape:SolidMolecular weight:272.25

