CAS 61155-84-8
:Poly-D-arginine
Description:
Poly-D-arginine, with the CAS number 61155-84-8, is a synthetic polymer composed of the amino acid arginine, specifically in its D-enantiomer form. This polymer is characterized by its cationic nature due to the presence of multiple guanidinium groups, which confer positive charges at physiological pH. Poly-D-arginine is known for its ability to interact with negatively charged molecules, such as nucleic acids and cell membranes, making it a valuable tool in various biomedical applications, including gene delivery and drug formulation. Its biocompatibility and biodegradability enhance its appeal in therapeutic contexts. Additionally, the polymer exhibits antimicrobial properties, which can be advantageous in preventing infections in medical settings. The structural properties of Poly-D-arginine, including its length and degree of polymerization, can influence its biological activity and efficacy. Overall, Poly-D-arginine serves as a versatile compound in research and clinical applications, particularly in the fields of molecular biology and nanomedicine.
Formula:(C6H14N4O2)x
InChI:InChI=1S/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t4-/m1/s1
InChI key:InChIKey=ODKSFYDXXFIFQN-SCSAIBSYSA-N
SMILES:C(CCNC(=N)N)[C@H](C(O)=O)N
Synonyms:- D-Arginine, homopolymer
- Poly-D-arginine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
