CAS 61191-90-0
:6-chloro-1-(4-fluorophenyl)hexan-1-one
Description:
6-Chloro-1-(4-fluorophenyl)hexan-1-one is an organic compound characterized by its ketone functional group and the presence of both chlorine and fluorine substituents. The molecular structure features a hexane backbone with a ketone group at one end and a para-fluorophenyl group attached to the first carbon. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It exhibits moderate polarity due to the presence of the carbonyl group, which can influence its solubility in various organic solvents. The chlorine and fluorine atoms contribute to its reactivity and potential applications in pharmaceuticals or agrochemicals, as halogenated compounds often exhibit unique biological activities. Additionally, the presence of these halogens can enhance the compound's stability and lipophilicity, making it suitable for various synthetic pathways in organic chemistry. Safety data should be consulted for handling, as halogenated compounds can pose health risks.
Formula:C12H14ClFO
InChI:InChI=1/C12H14ClFO/c13-9-3-1-2-4-12(15)10-5-7-11(14)8-6-10/h5-8H,1-4,9H2
SMILES:C(CCC(=O)c1ccc(cc1)F)CCCl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
6-Chloro-1-(4-fluorophenyl)-1-hexanone
CAS:Controlled ProductFormula:C12H14ClFOColor and Shape:NeatMolecular weight:228.69
