CAS 61193-04-2
:4,4-dimethyl-2,6-dioxopiperidine-3,5-dicarbonitrile
Description:
4,4-Dimethyl-2,6-dioxopiperidine-3,5-dicarbonitrile, with the CAS number 61193-04-2, is a heterocyclic organic compound characterized by its piperidine ring structure, which is substituted with two carbonitrile groups and two carbonyl groups. This compound typically exhibits a solid state at room temperature and is known for its potential applications in organic synthesis and medicinal chemistry due to its unique structural features. The presence of the dicarbonitrile groups contributes to its reactivity, making it a useful intermediate in the synthesis of various pharmaceuticals and agrochemicals. Additionally, the dimethyl substitutions enhance its lipophilicity, potentially influencing its biological activity and solubility in organic solvents. The compound's stability and reactivity can vary depending on the conditions, such as pH and temperature, which are important factors to consider in its handling and application. Overall, 4,4-dimethyl-2,6-dioxopiperidine-3,5-dicarbonitrile is a compound of interest in the field of synthetic organic chemistry.
Formula:C9H9N3O2
InChI:InChI=1/C9H9N3O2/c1-9(2)5(3-10)7(13)12-8(14)6(9)4-11/h5-6H,1-2H3,(H,12,13,14)
SMILES:CC1(C)C(C#N)C(=NC(=O)C1C#N)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
