CAS 612-19-1

2-Ethylbenzoic acid

Description:

2-Ethylbenzoic acid, with the CAS number 612-19-1, is an aromatic carboxylic acid characterized by the presence of both an ethyl group and a carboxylic acid functional group attached to a benzene ring. Its molecular formula is C10H12O2, indicating it contains ten carbon atoms, twelve hydrogen atoms, and two oxygen atoms. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature. It has a melting point that allows it to exist in solid form at room temperature, and it is soluble in organic solvents such as ethanol and ether, but has limited solubility in water. 2-Ethylbenzoic acid is known for its applications in organic synthesis and as an intermediate in the production of various chemicals. Its structure contributes to its reactivity, allowing it to participate in various chemical reactions, including esterification and acylation. Additionally, it may exhibit mild acidity due to the carboxylic acid group, making it relevant in both industrial and laboratory settings.

Formula: C₇H₁₃IN₂S₂

InChI: InChI=1/C7H12N2S2.HI/c1-3-8-6-5-7(9-4-2)11-10-6;/h5,8H,3-4H2,1-2H3;1H/b9-7-;

SMILES: CCNc1c/c(=N/CC)/ss1.I

Synonyms:

• N-[(3Z)-5-(ethylamino)-3H-1,2-dithiol-3-ylidene]ethanaminium iodide

2-Ethylbenzoic Acid

CAS: 612-19-1

Formula: C₉H₁₀O₂

Purity: >98.0%(GC)

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 150.18

Ref: 3B-E1347

2-Ethylbenzoic acid

CAS: 612-19-1

Formula: C₉H₁₀O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 150.1745

Ref: IN-DA00361Z

2-Ethylbenzoic acid

CAS: 612-19-1

2-Ethylbenzoic acid

Formula: C₉H₁₀O₂

Purity: 98%

Color and Shape: off white to faint beige solid

Molecular weight: 150.17g/mol

Ref: 54-OR16146

2-Ethylbenzoic acid

CAS: 612-19-1

2-Ethylbenzoic acid is a fatty acid that is found in plants, animals and microorganisms. It dissolves in water to form an amorphous drug with a molecular weight of about 170. 2-Ethylbenzoic acid has been shown to inhibit the activity of several enzymes, such as protein kinases and phospholipases. It also inhibits the activity of liver enzymes involved in the metabolism of drugs and other xenobiotics, such as phenylpropionic acid and malic acid. This drug has been shown to have an inhibitory effect on glucose uptake by cells and may be used as an anti-diabetic agent.

Formula: C₉H₁₀O₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 150.17 g/mol

Ref: 3D-FE70211

2-Ethylbenzoic acid

CAS: 612-19-1

Formula: C₉H₁₀O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 150.177

Ref: 10-F065724