CAS 612-34-0

2-Amino-N-(2-carboxyphenyl)benzamide

Description:

2-Amino-N-(2-carboxyphenyl)benzamide, also known by its CAS number 612-34-0, is an organic compound characterized by the presence of an amino group, a carboxylic acid group, and an amide functional group. This compound features a benzene ring substituted with both an amino group and a carboxyphenyl moiety, which contributes to its potential biological activity. It is typically a white to off-white solid, soluble in polar solvents due to the presence of the carboxylic acid group, which can engage in hydrogen bonding. The compound may exhibit properties such as being a potential ligand in coordination chemistry or a precursor in organic synthesis. Its structural features suggest it could participate in various chemical reactions, including acylation and amidation. Additionally, due to the presence of both amino and carboxylic acid functionalities, it may exhibit zwitterionic behavior in certain pH conditions, influencing its solubility and reactivity. Overall, 2-Amino-N-(2-carboxyphenyl)benzamide is of interest in both synthetic and medicinal chemistry contexts.

Formula: C₁₄H₁₂N₂O₃

InChI: InChI=1S/C14H12N2O3/c15-11-7-3-1-5-9(11)13(17)16-12-8-4-2-6-10(12)14(18)19/h1-8H,15H2,(H,16,17)(H,18,19)

InChI key: InChIKey=FECNOIODIVNEKI-UHFFFAOYSA-N

SMILES: N(C(=O)C1=C(N)C=CC=C1)C2=C(C(O)=O)C=CC=C2

Synonyms:

• Anthranilic acid, N-anthraniloyl-
• N-Anthranoylanthranilic acid
• 2-Amino-N-(2-carboxyphenyl)benzamide
• 2-[(2-Aminobenzoyl)amino]benzoic acid
• Benzoic acid, 2-[(2-aminobenzoyl)amino]-

2-[(2-aminobenzoyl)amino]benzoic acid

CAS: 612-34-0

Formula: C₁₄H₁₂N₂O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 256.2567

Ref: IN-DA00ECZB

2-(2-Aminobenzamido)benzoic acid

CAS: 612-34-0

2-(2-Aminobenzamido)benzoic acid

Purity: ≥95%

Molecular weight: 256.26g/mol

Ref: 54-OR97006

Tolvaptan Impurity 86

CAS: 612-34-0

Formula: C₁₄H₁₂N₂O₃

Molecular weight: 256.26

Ref: 4Z-T-69106

2-(2-Aminobenzamido)benzoic acid

CAS: 612-34-0

2-(2-Aminobenzamido)benzoic acid is a synthetic chemical that is used in the treatment of wastewater. It is a nitrogenous organic compound that is soluble in water and has a pH of 2. The aminophenols are converted to the corresponding diazonium salt by reaction with sodium carbonate and an acidic medium, which may be surface methodology or intermediates. The monoclonal antibodies are specific for skin cells, which are typically used to measure the concentration of this compound in urine samples.

Formula: C₁₄H₁₂N₂O₃

Purity: Min. 95%

Molecular weight: 256.26 g/mol

Ref: 3D-AAA61234