CAS 612-40-8
:2-(2-Carboxyethenyl)benzoic acid
Description:
2-(2-Carboxyethenyl)benzoic acid, also known as 2-(2-Carboxyvinyl)benzoic acid, is an organic compound characterized by its aromatic structure and the presence of both carboxylic acid and vinyl functional groups. It features a benzoic acid moiety with a vinyl group substituted at the ortho position relative to the carboxylic acid. This compound is typically a white to off-white solid and is soluble in polar solvents due to its carboxylic acid group. Its chemical properties include the ability to participate in various reactions such as esterification and polymerization, making it useful in organic synthesis and materials science. The presence of the carboxylic acid group allows it to act as a weak acid, contributing to its reactivity and potential applications in pharmaceuticals and agrochemicals. Additionally, its structural features may impart specific biological activities, which can be of interest in medicinal chemistry. As with many organic compounds, handling should be done with care, considering safety data and potential hazards.
Formula:C10H8O4
InChI:InChI=1S/C10H8O4/c11-9(12)6-5-7-3-1-2-4-8(7)10(13)14/h1-6H,(H,11,12)(H,13,14)
InChI key:InChIKey=SCWPNMHQRGNQHH-UHFFFAOYSA-N
SMILES:C(=CC(O)=O)C1=C(C(O)=O)C=CC=C1
Synonyms:- 2-(2-Carboxyethenyl)Benzoic Acid
- 2-Carboxycinnamic acid
- 2-[(E)-2-carboxyethenyl]benzoic acid
- 2-[(E)-2-carboxylatoethenyl]benzoate
- Benzoic acid, 2-(2-carboxyethenyl)-
- Cinnamic acid, o-carboxy-
- NSC 16636
- o-Carboxycinnamic acid
- 2-(2-Carboxyvinyl)benzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Carboxycinnamic acid, predominantly trans, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C10H8O4Purity:97%Color and Shape:White to cream, PowderMolecular weight:192.172-Carboxycinnamic acid (predominantly trans)
CAS:Formula:C10H8O4Purity:97%Color and Shape:SolidMolecular weight:192.17



