CAS 612-41-9
:3-(2-Nitrophenyl)-2-propenoic acid
Description:
3-(2-Nitrophenyl)-2-propenoic acid, also known as nitrophenyl acrylic acid, is an organic compound characterized by its structure, which features a nitrophenyl group attached to an acrylic acid moiety. This compound typically appears as a yellow crystalline solid and is known for its aromatic properties due to the presence of the nitrophenyl group. It is soluble in organic solvents but has limited solubility in water. The presence of the nitro group contributes to its reactivity, making it a useful intermediate in organic synthesis, particularly in the production of dyes, pharmaceuticals, and agrochemicals. Additionally, the compound exhibits potential biological activity, which may be of interest in medicinal chemistry. Its chemical behavior can be influenced by factors such as pH and temperature, and it may undergo various reactions, including electrophilic substitution and polymerization. Safety precautions should be taken when handling this compound, as nitro compounds can be hazardous.
Formula:C9H7NO4
InChI:InChI=1S/C9H7NO4/c11-9(12)6-5-7-3-1-2-4-8(7)10(13)14/h1-6H,(H,11,12)
InChI key:InChIKey=BBQDLDVSEDAYAA-UHFFFAOYSA-N
SMILES:C(=CC(O)=O)C1=C(N(=O)=O)C=CC=C1
Synonyms:- (2E)-3-(2-Nitrophenyl)-2-propenoic acid
- (2E)-3-(2-nitrophenyl)prop-2-enoate
- (2E)-3-(2-nitrophenyl)prop-2-enoic acid
- 2-Nitrobenzenepropenoic acid
- 2-Nitrocinnamic acid
- 2-Propenoic acid, 3-(2-nitrophenyl)-
- 2-Propenoic acid, 3-(2-nitrophenyl)-, (2E)-
- 3-(2-Nitrophenyl)-2-Propenoicaci
- 3-(2-Nitrophenyl)-2-Propenoicacid
- 3-(2-Nitrophenyl)-2-propenoic acid
- 3-(2-Nitrophenyl)Prop-2-Enoic Acid
- 3-(2-Nitrophenyl)acrylic acid
- 3-(2-Nitrophenyl)propenoic acid
- Akos Bbs-00002619
- Cinnamic acid, o-nitro-
- Labotest-Bb Lt00005559
- NSC 14018
- NSC 638145
- Trans-2-Nitrocinnamic Acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Propenoic acid, 3-(nitrophenyl)-
CAS:Formula:C9H7NO4Purity:98%Color and Shape:SolidMolecular weight:193.15623-(2-Nitrophenyl)acrylic acid
CAS:Formula:C9H7NO4Purity:98%Color and Shape:SolidMolecular weight:193.1582-Nitrocinnamic acid
CAS:2-Nitrocinnamic acid is a synthetic compound that is used as a precursor in the manufacture of dyes. It has been shown to be genotoxic, which means it can cause genetic mutations. 2-Nitrocinnamic acid also induces the synthesis of cinnamic acid derivatives and is hydrolyzed by nitroreductases, leading to reactive oxygen species that are genotoxic. Nitrocinnamic acid may also cause cancerous effects on human lymphocytes.
Formula:C9H7NO4Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:193.16 g/molRef: 3D-FN67686
Discontinued product



