CAS 6120-63-4
:(thr6)-bradykinin
Description:
(Thr6)-bradykinin, with the CAS number 6120-63-4, is a synthetic analog of the naturally occurring peptide bradykinin, which is a potent vasodilator involved in various physiological processes, including inflammation and pain modulation. This peptide consists of a chain of amino acids, specifically designed to enhance its stability and biological activity compared to its parent compound. Characteristically, (Thr6)-bradykinin exhibits increased resistance to enzymatic degradation, which prolongs its action in biological systems. It interacts with bradykinin receptors, primarily B2 receptors, leading to effects such as vasodilation, increased vascular permeability, and stimulation of pain pathways. The substitution of threonine at the sixth position is crucial for its enhanced pharmacological properties. In research and therapeutic contexts, (Thr6)-bradykinin is studied for its potential applications in cardiovascular health, pain management, and as a tool for understanding bradykinin-related signaling pathways. Its stability and efficacy make it a valuable compound in both experimental and clinical settings.
Formula:C51H75N15O11
InChI:InChI=1/C51H75N15O11/c1-30(67)41(48(75)65-25-11-20-38(65)45(72)62-36(28-32-15-6-3-7-16-32)42(69)61-34(49(76)77)18-9-23-58-51(55)56)63-43(70)35(27-31-13-4-2-5-14-31)60-40(68)29-59-44(71)37-19-10-24-64(37)47(74)39-21-12-26-66(39)46(73)33(52)17-8-22-57-50(53)54/h2-7,13-16,30,33-39,41,67H,8-12,17-29,52H2,1H3,(H,59,71)(H,60,68)(H,61,69)(H,62,72)(H,63,70)(H,76,77)(H4,53,54,57)(H4,55,56,58)/t30-,33+,34+,35+,36+,37+,38+,39+,41+/m1/s1
Synonyms:- H-Arg-Pro-Pro-Gly-Phe-Thr-Pro-Phe-Arg-OH
- N~5~-(diaminomethylidene)-L-ornithyl-L-prolyl-L-prolylglycyl-L-phenylalanyl-L-threonyl-L-prolyl-L-phenylalanyl-N~5~-(diaminomethylidene)-L-ornithine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
(Thr6)-Bradykinin
CAS:Bradykinin is a peptide hormone that functions as a neurotransmitter, neuromodulator, and vasodilator. Bradykinin is released from the cell in response to tissue injury or inflammation. Bradykinin binds to the bradykinin receptors B2 and B1 on the surface of cells and stimulates them, which causes pain relief and vasodilation. Bradykinin is synthesized as an inactive pro-peptide (Tyr6) that undergoes proteolytic cleavage by proteases such as thrombin, trypsin, chymotrypsin, and elastase. The amino acid sequence of the active form of bradykinin is Thr6-Bradykinin H-Arg-Pro-Pro-Gly-Phe-Thr-Pro-Phe-Arg-OH.Formula:C51H75N15O11Purity:Min. 95%Molecular weight:1,074.24 g/mol
