CAS 61200-59-7

4,5-Dichloro-3-thiophenecarboxaldehyde

Description:

4,5-Dichloro-3-thiophenecarboxaldehyde is an organic compound characterized by the presence of a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features two chlorine atoms substituted at the 4 and 5 positions of the thiophene ring, along with a carboxaldehyde functional group (-CHO) at the 3 position. The presence of chlorine atoms enhances its reactivity and may influence its physical properties, such as solubility and boiling point. The thiophene ring contributes to its aromatic character, which can affect its stability and reactivity in various chemical reactions. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals, agrochemicals, or other fine chemicals. Its unique structure allows for potential applications in materials science and as a building block for more complex molecules. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.

Formula: C₅H₂Cl₂OS

InChI: InChI=1S/C5H2Cl2OS/c6-4-3(1-8)2-9-5(4)7/h1-2H

InChI key: InChIKey=JTXSCOQHYKKFMH-UHFFFAOYSA-N

SMILES: C(=O)C=1C(Cl)=C(Cl)SC1

Synonyms:

• 3-Thiophenecarboxaldehyde, 4,5-dichloro-
• 4,5-Dichloro-3-thiophenecarboxaldehyde

4,5-Dichlorothiophene-3-carbaldehyde

CAS: 61200-59-7

Versatile small molecule scaffold

Formula: C₅H₂Cl₂OS

Purity: Min. 95%

Molecular weight: 181.04 g/mol

Ref: 3D-LCA20059