CAS 61203-48-3

2-Iodo-4,5-dimethoxybenzoic acid

Description:

2-Iodo-4,5-dimethoxybenzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with iodine and methoxy groups. The presence of the iodine atom at the 2-position and two methoxy groups at the 4 and 5 positions contributes to its unique chemical properties, including increased lipophilicity and potential for various chemical reactions. This compound is typically a white to off-white solid and is soluble in organic solvents, while its solubility in water is limited due to the hydrophobic nature of the methoxy groups. The methoxy substituents can influence the compound's reactivity, making it a potential candidate for various synthetic applications in organic chemistry. Additionally, the presence of the carboxylic acid functional group allows for further derivatization, making it useful in the synthesis of more complex molecules. Its iodine substituent may also impart interesting biological activities, which could be explored in medicinal chemistry. Overall, 2-Iodo-4,5-dimethoxybenzoic acid is a versatile compound with potential applications in both research and industry.

Formula: C₉H₉IO₄

InChI: InChI=1/C9H9IO4/c1-13-7-3-5(9(11)12)6(10)4-8(7)14-2/h3-4H,1-2H3,(H,11,12)

InChI key: InChIKey=HLLHFIIJEOARHX-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(I)C=C(OC)C(OC)=C1

Synonyms:

• 2-Iodo-4,5-Dimethoxybenzoic Acid
• Benzoic acid, 2-iodo-4,5-dimethoxy-
• Veratric acid, 6-iodo-
• 4,5-Dimethoxy-2-iodobenzoic acid

4,5-DIMETHOXY-2-IODOBENZOIC ACID

CAS: 61203-48-3

Formula: C₉H₉IO₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 308.0698

Ref: IN-DA00EAAQ

2-Iodo-4,5-dimethoxybenzoic acid

CAS: 61203-48-3

2-Iodo-4,5-dimethoxybenzoic acid

Purity: 98%

Molecular weight: 308.07g/mol

Ref: 54-OR95873

4,5-Dimethoxy-2-iodobenzoic acid

CAS: 61203-48-3

Formula: C₉H₉IO₄

Purity: 96%

Color and Shape: Solid

Molecular weight: 308.071

Ref: 10-F132500

4,5-Dimethoxy-2-iodobenzoic acid

CAS: 61203-48-3

4,5-Dimethoxy-2-iodobenzoic acid is a diazo compound that belongs to the class of aryl ethyl compounds. It is an efficient method for the synthesis of unsymmetrical aryl ethyl compounds. This compound has been shown to have potent antitumor activity against experimental tumors in mice when given orally. 4,5-Dimethoxy-2-iodobenzoic acid inhibits tumor cell proliferation by blocking DNA synthesis and transcription. It also binds to receptor protein kinase C, which may be responsible for its antitumor activity.

Formula: C₉H₉IO₄

Purity: Min. 95%

Molecular weight: 308.07 g/mol

Ref: 3D-LCA20348