CAS 61203-54-1

4-Bromo-2,6-dimethoxybenzoic acid

Description:

4-Bromo-2,6-dimethoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of a bromine atom and two methoxy groups on a benzene ring. The molecular structure features a carboxylic acid functional group (-COOH) that contributes to its acidic properties. This compound is typically a white to off-white solid and is soluble in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the aromatic system. The presence of the bromine atom enhances its reactivity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The methoxy groups can influence the compound's electronic properties and steric hindrance, affecting its reactivity and interactions with other molecules. Additionally, 4-Bromo-2,6-dimethoxybenzoic acid may exhibit biological activity, which can be explored in various chemical and biological research applications. Proper handling and safety measures should be observed due to its potential hazards as with many organic compounds.

Formula: C₉H₉BrO₄

InChI: InChI=1S/C9H9BrO4/c1-13-6-3-5(10)4-7(14-2)8(6)9(11)12/h3-4H,1-2H3,(H,11,12)

InChI key: InChIKey=SGXLLIOGWIOYDZ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(OC)C=C(Br)C=C1OC

Synonyms:

• Benzoic acid, 4-bromo-2,6-dimethoxy-
• 4-Bromo-2,6-dimethoxybenzoic acid

4-bromo-2,6-dimethoxybenzoic acid

CAS: 61203-54-1

Formula: C₉H₉BrO₄

Purity: 98%

Molecular weight: 261.0694

Ref: IN-DA01EL7V

4-Bromo-2,6-dimethoxybenzoic acid

CAS: 61203-54-1

4-Bromo-2,6-dimethoxybenzoic acid

Purity: 98%

Molecular weight: 261.07g/mol

Ref: 54-OR1034019

4-Bromo-2,6-dimethoxybenzoic acid

CAS: 61203-54-1

Purity: 98%

Molecular weight: 261.0710144

Ref: 10-F761713