CAS 61204-01-1: 4-(trans-4-Pentylcyclohexyl)benzonitrile
Description:4-(trans-4-Pentylcyclohexyl)benzonitrile, with the CAS number 61204-01-1, is a chemical compound that belongs to the class of liquid crystals, specifically a type of calamitic liquid crystal. This substance is characterized by its unique molecular structure, which includes a benzonitrile moiety and a pentylcyclohexyl group, contributing to its liquid crystalline properties. It typically exhibits a mesogenic behavior, meaning it can form ordered phases between solid and liquid states, which is essential for applications in display technologies. The compound is generally non-toxic and has a moderate thermal stability, making it suitable for various applications in the field of materials science. Its phase transition temperatures, such as the melting point and the clearing point, are critical for determining its usability in liquid crystal displays (LCDs). Additionally, the presence of the nitrile functional group may impart specific chemical reactivity and solubility characteristics, influencing its interactions with other materials in formulations. Overall, this compound is significant in the development of advanced liquid crystal materials.
Formula:C18H25N
InChI:InChI=1/C18H25N/c1-2-3-4-5-15-6-10-17(11-7-15)18-12-8-16(14-19)9-13-18/h8-9,12-13,15,17H,2-7,10-11H2,1H3/t15-,17-
InChI key:InChIKey=FURZYCFZFBYJBT-JCNLHEQBNA-N
SMILES:N#CC1=CC=C(C=C1)C2CCC(CCCCC)CC2
- Synonyms:
- 1-p-Cyanophenyl-4-pentylcyclohexane
- 4-(4-Pentylcyclohexyl)Benzonitrile
- 4-(trans-4′-n-Pentylcyclohexyl)-1-cyanobenzene
- 4-Cyano-1-[trans-4-pentylcyclohexyl]benzene
- 4-Pentyl-4′-cyanophenylcyclohexane
- 5-Hb-C
- Benzonitrile, 4-(4-pentylcyclohexyl)-, trans-
- Benzonitrile, 4-(trans-4-pentylcyclohexyl)-
- Cp-5-N
- Licristal S 1114
- See more synonyms
- Merck ZLI 1114
- Pch 5
- S 1114
- ZhKM 1098
- Zli 1114
- p-Pentyl-p′-cyanophenylcyclohexane
- p-trans-4-Pentylcyclohexylbenzonitrile
- trans-4-(4-Pentylcyclohexyl)benzonitrile
- trans-4-Amyl-1-(4-cyanophenyl)cyclohexane
- trans-4-Pentyl(4-cyanophenyl)cyclohexane
- trans-4-Pentyl-1-(4-cyanophenyl)cyclohexane
- trans-4-Pentyl-1-(p-cyanophenyl)cyclohexane
- 4-(Trans-4-Pentylcyclohexyl) Benzonitrile
- 4-(trans-4-Pentylcyclohexyl)benzonitrile
