CAS 61218-44-8: (6aS,12aS)-6H-[1,3]dioxolo[5,6][1]benzofuro[3,2-c]chromene-3,6a(12aH)-diol
Description:The chemical substance known as "(6aS,12aS)-6H-[1,3]dioxolo[5,6][1]benzofuro[3,2-c]chromene-3,6a(12aH)-diol," with the CAS number 61218-44-8, is a complex organic compound characterized by its unique bicyclic structure that incorporates both dioxole and chromene moieties. This compound features multiple hydroxyl groups, which contribute to its potential reactivity and solubility in various solvents. The stereochemistry indicated by the (6aS,12aS) configuration suggests specific spatial arrangements of atoms, which can influence its biological activity and interactions with other molecules. Such compounds often exhibit interesting pharmacological properties, making them subjects of interest in medicinal chemistry and drug development. Additionally, the presence of fused ring systems typically enhances the stability and rigidity of the molecule, which can be advantageous in various applications, including as potential therapeutic agents or in materials science. Overall, this compound exemplifies the intricate nature of organic chemistry and the diverse functionalities that can arise from complex molecular architectures.
Formula:C16H12O6
InChI:InChI=1/C16H12O6/c17-8-1-2-9-11(3-8)19-6-16(18)10-4-13-14(21-7-20-13)5-12(10)22-15(9)16/h1-5,15,17-18H,6-7H2/t15-,16+/m0/s1

6α-Hydroxymaackiain
Ref: TM-TN3199
5mg | 552.00 € |

6a-Hydroxymaackiain
Ref: BP-SBP02758
Undefined size | To inquire |

6α-Hydroxymaackiain
Ref: 3D-LCA21844
1mg | 874.00 € | ||
2mg | 1,026.00 € | ||
5mg | 1,450.00 € | ||
10mg | 2,354.00 € |