CAS 61218-44-8
:(6aS,12aS)-6H-[1,3]dioxolo[5,6][1]benzofuro[3,2-c]chromene-3,6a(12aH)-diol
Description:
The chemical substance known as "(6aS,12aS)-6H-[1,3]dioxolo[5,6][1]benzofuro[3,2-c]chromene-3,6a(12aH)-diol," with the CAS number 61218-44-8, is a complex organic compound characterized by its unique bicyclic structure that incorporates both dioxole and chromene moieties. This compound features multiple hydroxyl groups, which contribute to its potential reactivity and solubility in various solvents. The stereochemistry indicated by the (6aS,12aS) configuration suggests specific spatial arrangements of atoms, which can influence its biological activity and interactions with other molecules. Such compounds often exhibit interesting pharmacological properties, making them subjects of interest in medicinal chemistry and drug development. Additionally, the presence of fused ring systems typically enhances the stability and rigidity of the molecule, which can be advantageous in various applications, including as potential therapeutic agents or in materials science. Overall, this compound exemplifies the intricate nature of organic chemistry and the diverse functionalities that can arise from complex molecular architectures.
Formula:C16H12O6
InChI:InChI=1/C16H12O6/c17-8-1-2-9-11(3-8)19-6-16(18)10-4-13-14(21-7-20-13)5-12(10)22-15(9)16/h1-5,15,17-18H,6-7H2/t15-,16+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
6α-Hydroxymaackiain
CAS:6alpha-Hydroxymaackiain is a natural product from Derris robusta.Formula:C16H12O6Purity:98%Color and Shape:SolidMolecular weight:300.266α-Hydroxymaackiain
CAS:6α-Hydroxymaackiain is a natural product that belongs to the group of isoflavones and has shown to be an x-ray crystal structure. 6α-Hydroxymaackiain binds to DNA, inhibiting bacterial replication and growth. It also stimulates the production of phytoalexins, which are antimicrobial substances produced by plants in response to microbial attack. 6α-Hydroxymaackiain has been shown to be effective against bacterial strains that are resistant to other antibiotics such as erythromycin and penicillin. The optimum pH for 6α-hydroxymaackiain activity is between 5 and 7.6. There are no sequences available for this product.Formula:C16H12O6Purity:Min. 95%Molecular weight:300.26 g/mol




