CAS 61220-49-3

3-(2-Bromoethyl)-1-methyl-1H-indole

Description:

3-(2-Bromoethyl)-1-methyl-1H-indole, with the CAS number 61220-49-3, is a chemical compound that belongs to the indole family, characterized by its bicyclic structure comprising a benzene ring fused to a pyrrole ring. This compound features a bromoethyl group at the 3-position of the indole, which introduces a halogen substituent that can influence its reactivity and biological activity. The presence of the methyl group at the 1-position contributes to its overall stability and solubility properties. Typically, compounds like this can exhibit a range of biological activities, making them of interest in medicinal chemistry and drug development. The bromoethyl moiety can serve as a reactive site for further chemical modifications or interactions with biological targets. Additionally, the compound's properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and solvents used. Overall, 3-(2-Bromoethyl)-1-methyl-1H-indole is a versatile compound with potential applications in various fields, including pharmaceuticals and organic synthesis.

Formula: C₁₁H₁₂BrN

InChI: InChI=1S/C11H12BrN/c1-13-8-9(6-7-12)10-4-2-3-5-11(10)13/h2-5,8H,6-7H2,1H3

InChI key: InChIKey=GGGKTMYGNHOBHF-UHFFFAOYSA-N

SMILES: C(CBr)C=1C=2C(N(C)C1)=CC=CC2

Synonyms:

• 1-Methyl-3-(2-bromoethyl)indole
• 1H-Indole, 3-(2-bromoethyl)-1-methyl-
• 3-(2-Bromoethyl)-1-methyl-1H-indole
• 3-(2-Bromoethyl)-1-methylindole

3-(2-Bromoethyl)-1-methyl-1H-indole

Controlled Product

CAS: 61220-49-3

Versatile small molecule scaffold

Formula: C₁₁H₁₂BrN

Purity: Min. 95%

Molecular weight: 238.12 g/mol

Ref: 3D-LCA22049