
CAS 61221-41-8
:2-Hydroxy-4,5-dihydro[1,3]dioxolo[4,5-j]pyrrolo[3,2,1-de]phenanthridinium acetate
Description:
2-Hydroxy-4,5-dihydro[1,3]dioxolo[4,5-j]pyrrolo[3,2,1-de]phenanthridinium acetate, with the CAS number 61221-41-8, is a complex organic compound characterized by its unique structural features, including a phenanthridinium core and a dioxole moiety. This compound typically exhibits properties associated with its heterocyclic structure, such as potential fluorescence and reactivity due to the presence of multiple functional groups. It may display solubility in polar solvents, which is common for many heterocycles, and could be involved in various chemical reactions, including electrophilic substitutions or nucleophilic attacks. The hydroxyl group contributes to its potential as a ligand in coordination chemistry, while the acetate moiety may influence its solubility and reactivity. Additionally, compounds of this nature are often studied for their biological activities, including antimicrobial or anticancer properties, due to their complex ring systems and functional groups. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry, with potential applications in pharmaceuticals and materials science.
Formula:C18H15NO5
InChI:InChI=1/C16H11NO3.C2H4O2/c18-11-3-9-1-2-17-7-10-4-14-15(20-8-19-14)6-12(10)13(5-11)16(9)17;1-2(3)4/h3-7H,1-2,8H2;1H3,(H,3,4)
SMILES:C1Cn2cc3cc4c(cc3c3cc(=O)cc1c23)OCO4.CC(=O)O
Synonyms:- Ungerimine acetate
- Ungeremine acetate
- Lycobetaine acetate
- At-1840
- 2-Hydroxy-4,5-Dihydro[1,3]Dioxolo[4,5-J]Pyrrolo[3,2,1-De]Phenanthridin-6-Ium
- 2-Hydroxy-4,5-Dihydro[1,3]Dioxolo[4,5-J]Pyrrolo[3,2,1-De]Phenanthridin-6-Ium Acetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Lycobetaine acetate
CAS:Lycobetaine acetate combats fungi Penicillium roqueforti & Aspergillus niger; Ungeremine is antibacterial against Flavobacterium columnare.Formula:C18H15NO5Purity:99.84%Color and Shape:SolidMolecular weight:325.32Lycobetaine
CAS:Lycobetaine is a positively charged ion channel activator and inhibitor with high purity. It has been used extensively as a research tool in pharmacology, cell biology, and biochemistry. Lycobetaine has been shown to inhibit the binding of an antibody to its receptor by competing for the receptor site on the antibody. The peptide has also been shown to activate ion channels by interacting with their binding sites on the protein surface. Lycobetaine has a molecular weight of 6071 Da and is soluble at pH 2-6.
Formula:C18H15NO5Purity:Min. 95%Molecular weight:325.3 g/mol


