CAS 61227-25-6

5-hydroxy-2-methoxybenzoic acid

Description:

5-Hydroxy-2-methoxybenzoic acid, also known as gentisic acid, is an aromatic compound characterized by the presence of both hydroxyl (-OH) and methoxy (-OCH₃) functional groups attached to a benzoic acid structure. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to its ability to form hydrogen bonds. The presence of the hydroxyl group contributes to its acidity, allowing it to act as a weak acid in solution. Gentisic acid is known for its antioxidant properties and has been studied for potential applications in pharmaceuticals and as a natural preservative. It can also participate in various chemical reactions, including esterification and oxidation. Additionally, it is important in biochemical pathways, particularly in the metabolism of certain phenolic compounds. Overall, 5-hydroxy-2-methoxybenzoic acid is a versatile compound with significant relevance in both organic chemistry and biochemistry.

Formula: C₈H₈O₄

InChI: InChI=1/C8H8O4/c1-12-7-3-2-5(9)4-6(7)8(10)11/h2-4,9H,1H3,(H,10,11)

SMILES: COc1ccc(cc1C(=O)O)O

Synonyms:

• Benzoic Acid, 5-Hydroxy-2-Methoxy-

3-HYDROXY-6-METHOXYBENZOIC ACID

CAS: 61227-25-6

Formula: C₈H₈O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 168.1467

Ref: IN-DA00EYMM

5-Hydroxy-2-methoxybenzoic acid

CAS: 61227-25-6

5-Hydroxy-2-methoxybenzoic acid

Purity: 98%

Molecular weight: 168.15g/mol

Ref: 54-OR77415

5-Hydroxy-2-methoxybenzoic acid

CAS: 61227-25-6

Apigenin is a flavonoid found in plants of the genus Labiatae, such as chamomile and feverfew. It is a potent anti-inflammatory agent that may be due to its ability to inhibit cyclooxygenase (COX) enzymes and subsequent production of proinflammatory prostaglandins, leukotrienes, and thromboxanes. Apigenin has also been shown to inhibit cancer cell growth by binding to DNA and inhibiting transcription. Apigenin is chemically stable at room temperature and has been used in techniques such as liquid chromatography-mass spectrometry (LC-MS).

Formula: C₈H₈O₄

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 168.14 g/mol

Ref: 3D-LCA22725

5-Hydroxy-2-methoxybenzoic acid

CAS: 61227-25-6

Formula: C₈H₈O₄

Purity: 98%

Molecular weight: 168.148

Ref: 10-F328507

5-Hydroxy-2-methoxybenzoic acid

Controlled Product

CAS: 61227-25-6

Formula: C₈H₈O₄

Color and Shape: Neat

Molecular weight: 168.15

Ref: TR-H855035