CAS 61229-06-9
:(5E)-7-methyloct-5-enoic acid
Description:
(5E)-7-methyloct-5-enoic acid, with the CAS number 61229-06-9, is an unsaturated fatty acid characterized by its long carbon chain and the presence of a double bond in the alkene configuration. This compound features a total of eight carbon atoms, with a double bond located between the fifth and sixth carbon atoms, which contributes to its reactivity and potential applications in organic synthesis. The presence of a carboxylic acid functional group (-COOH) at one end of the molecule imparts acidic properties, making it soluble in polar solvents and capable of participating in various chemical reactions, such as esterification and amidation. The specific configuration of the double bond (E or trans) influences its physical properties, including boiling and melting points, as well as its biological activity. Such compounds are often studied for their roles in biochemistry and potential applications in the development of pharmaceuticals, agrochemicals, and as intermediates in organic synthesis.
Formula:C9H16O2
InChI:InChI=1/C9H16O2/c1-8(2)6-4-3-5-7-9(10)11/h4,6,8H,3,5,7H2,1-2H3,(H,10,11)/b6-4+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
