CAS 61229-08-1
:Norcapsaicin
Description:
Norcapsaicin, with the CAS number 61229-08-1, is a chemical compound that is structurally related to capsaicin, the active component found in chili peppers responsible for their heat. It is classified as an alkaloid and is known for its pungent flavor and potential therapeutic properties. Norcapsaicin is characterized by its ability to interact with the TRPV1 receptor, which is involved in the sensation of pain and temperature. This interaction can lead to a burning sensation, similar to that caused by capsaicin, but with distinct pharmacological effects. The compound is often studied for its potential applications in pain relief and anti-inflammatory treatments. In terms of physical properties, norcapsaicin is typically a colorless to pale yellow liquid, and it is soluble in organic solvents. Its stability and reactivity can vary depending on environmental conditions, making it important to handle it with care in laboratory settings. Overall, norcapsaicin represents a significant area of interest in both food science and medicinal chemistry.
Formula:C17H25NO3
InChI:InChI=1S/C17H25NO3/c1-13(2)7-5-4-6-8-17(20)18-12-14-9-10-15(19)16(11-14)21-3/h5,7,9-11,13,19H,4,6,8,12H2,1-3H3,(H,18,20)/b7-5+
InChI key:InChIKey=UTNZMGHHFHHIAY-FNORWQNLSA-N
SMILES:C(NC(CCC/C=C/C(C)C)=O)C1=CC(OC)=C(O)C=C1
Synonyms:- 5-Octenamide, N-[(4-hydroxy-3-methoxyphenyl)methyl]-7-methyl-, (5E)-
- Norcapsaicin
- (5E)-N-[(4-Hydroxy-3-methoxyphenyl)methyl]-7-methyl-5-octenamide
- 5-Octenamide, N-[(4-hydroxy-3-methoxyphenyl)methyl]-7-methyl-, (E)-
- E-Norcapsaicin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
