CAS 61239-34-7

3-amino-N-(4-chlorophenyl)-3-(hydroxyimino)propanamide

Description:

3-amino-N-(4-chlorophenyl)-3-(hydroxyimino)propanamide, with the CAS number 61239-34-7, is an organic compound characterized by its functional groups, which include an amino group, a hydroxylamine moiety, and an amide linkage. This compound features a propanamide backbone, where the amino group is attached to the third carbon, and a 4-chlorophenyl group is substituted at the nitrogen atom of the amide. The presence of the hydroxylamine group contributes to its potential reactivity, particularly in forming oximes or participating in various chemical reactions. The chlorophenyl substituent may influence the compound's biological activity and solubility properties. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals or agrochemicals due to their structural characteristics, which may impart specific biological activities. Additionally, the compound's stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature.

Formula: C₉H₁₀ClN₃O₂

InChI: InChI=1/C9H10ClN3O2/c10-6-1-3-7(4-2-6)12-9(14)5-8(11)13-15/h1-4,15H,5H2,(H2,11,13)(H,12,14)

SMILES: c1cc(ccc1Cl)NC(=O)CC(=N)NO

Synonyms:

• (3E)-3-Amino-N-(4-chlorophenyl)-3-(hydroxyimino)propanamide
• N-(4-Chloro-phenyl)-2-(N-hydroxycarbamimidoyl)-acetamide

N-(4-Chlorophenyl)-3-(hydroxyamino)-3-iminopropanamide

CAS: 61239-34-7

Formula: C₉H₁₀ClN₃O₂

Molecular weight: 227.6476

Ref: IN-DA00ELSH

N-(4-Chlorophenyl)-3-(hydroxyamino)-3-iminopropanamide

CAS: 61239-34-7

Formula: C₉H₁₀ClN₃O₂

Purity: 95.0%

Molecular weight: 227.65

Ref: 10-F240641

N-(4-Chlorophenyl)-2-(N'-hydroxycarbamimidoyl)acetamide

CAS: 61239-34-7

Versatile small molecule scaffold

Formula: C₉H₁₀ClN₃O₂

Purity: Min. 95%

Molecular weight: 227.65 g/mol

Ref: 3D-LCA23934