CAS 6124-13-6

ethyl 3-methyl-5-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate

Description:

Ethyl 3-methyl-5-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate, with CAS number 6124-13-6, is a heterocyclic compound characterized by its thiazole and pyrimidine rings. This compound typically exhibits a range of biological activities, making it of interest in medicinal chemistry. It is known for its potential as an intermediate in the synthesis of various pharmaceuticals. The presence of the ethyl ester group contributes to its solubility and reactivity, while the methyl and oxo substituents can influence its pharmacological properties. The thiazolo and pyrimidine moieties are often associated with diverse biological functions, including antimicrobial and anticancer activities. In terms of physical properties, it may be a solid at room temperature, with specific melting and boiling points dependent on its purity and crystalline form. Overall, this compound represents a valuable scaffold for further chemical modifications aimed at enhancing its therapeutic potential.

Formula: C₁₀H₁₀N₂O₃S

InChI: InChI=1/C10H10N2O3S/c1-3-15-9(14)7-4-11-10-12(8(7)13)6(2)5-16-10/h4-5H,3H2,1-2H3

SMILES: CCOC(=O)c1cnc2n(c(C)cs2)c1=O

Ethyl 3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate

CAS: 6124-13-6

Versatile small molecule scaffold

Formula: C₁₀H₁₀N₂O₃S

Purity: Min. 95%

Molecular weight: 238.27 g/mol

Ref: 3D-GAA12413