CAS 61249-37-4

N-benzyl-6-chloro-1,3-benzothiazol-2-amine

Description:

N-benzyl-6-chloro-1,3-benzothiazol-2-amine is a chemical compound characterized by its benzothiazole core, which features a chlorine atom and an amine group. This compound typically exhibits properties associated with heterocyclic aromatic compounds, including potential biological activity due to the presence of the amine and halogen substituents. The benzyl group enhances its lipophilicity, which may influence its solubility and interaction with biological systems. The chlorine atom can affect the compound's reactivity and stability, making it a subject of interest in medicinal chemistry and drug development. Additionally, compounds of this class may exhibit antimicrobial, antifungal, or anticancer properties, although specific biological activities would depend on further empirical studies. Its synthesis and characterization would involve standard organic chemistry techniques, and safety precautions should be observed due to the presence of chlorine and potential toxicity associated with amines. Overall, N-benzyl-6-chloro-1,3-benzothiazol-2-amine represents a versatile scaffold for further chemical modifications and applications in various fields.

Formula: C₁₄H₁₁ClN₂S

InChI: InChI=1/C14H11ClN2S/c15-11-6-7-12-13(8-11)18-14(17-12)16-9-10-4-2-1-3-5-10/h1-8H,9H2,(H,16,17)

SMILES: c1ccc(cc1)CN=c1[nH]c2ccc(cc2s1)Cl

Synonyms:

• 2-benzothiazolamine, 6-chloro-N-(phenylmethyl)-
• N-Benzyl-6-chloro-1,3-benzothiazol-2-amine

N-Benzyl-6-chlorobenzo[D]thiazol-2-amine

CAS: 61249-37-4

Versatile small molecule scaffold

Formula: C₁₄H₁₁ClN₂S

Purity: Min. 95%

Molecular weight: 274.8 g/mol

Ref: 3D-LCA24937