CAS 6125-33-3

2-chloro-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]acetamide

Description:

2-Chloro-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]acetamide is a chemical compound characterized by its unique structural features, which include a chloro group, an acetamide functional group, and a thiazole ring substituted with a nitrophenyl moiety. This compound typically exhibits a solid state at room temperature and is soluble in polar organic solvents. The presence of the chloro and nitro groups contributes to its potential reactivity and biological activity, making it of interest in medicinal chemistry and pharmacology. The thiazole ring is known for its role in various biological activities, including antimicrobial and anticancer properties. The compound's molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, influencing its solubility and reactivity. Additionally, the presence of the nitro group may enhance its electron-withdrawing properties, affecting its overall chemical behavior. As with many organic compounds, safety precautions should be taken when handling this substance due to potential toxicity and environmental impact.

Formula: C₁₁H₈ClN₃O₃S

InChI: InChI=1/C11H8ClN3O3S/c12-5-10(16)14-11-13-9(6-19-11)7-2-1-3-8(4-7)15(17)18/h1-4,6H,5H2,(H,13,14,16)

Synonyms:

• 2-Chloro-N-[4-(3-nitro-phenyl)-thiazol-2-yl]-acetamide

2-Chloro-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]acetamide

CAS: 6125-33-3

Versatile small molecule scaffold

Formula: C₁₁H₈ClN₃O₃S

Purity: Min. 95%

Molecular weight: 297.72 g/mol

Ref: 3D-GAA12533