CAS 6125-36-6
:4-fluoro-N-(2-methyl-3-nitrophenyl)benzenesulfonamide
Description:
4-Fluoro-N-(2-methyl-3-nitrophenyl)benzenesulfonamide, identified by its CAS number 6125-36-6, is a chemical compound that belongs to the class of sulfonamides, which are characterized by the presence of a sulfonyl group (–SO2–) attached to an amine. This compound features a fluorine atom at the para position of the aniline moiety, which can influence its electronic properties and reactivity. The presence of a nitro group and a methyl group on the aromatic ring contributes to its overall polarity and potential biological activity. Typically, sulfonamides exhibit antibacterial properties, and modifications in their structure can affect their pharmacological profiles. The compound is likely to be a solid at room temperature, with solubility varying based on the solvent used. Its synthesis and application may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals. As with all chemical substances, proper handling and safety precautions should be observed due to potential toxicity and environmental impact.
Formula:C13H11FN2O4S
InChI:InChI=1/C13H11FN2O4S/c1-9-12(3-2-4-13(9)16(17)18)15-21(19,20)11-7-5-10(14)6-8-11/h2-8,15H,1H3
SMILES:Cc1c(cccc1N(=O)=O)NS(=O)(=O)c1ccc(cc1)F
Synonyms:- 4-Fluoro-N-(2-methyl-3-nitro-phenyl)-benzenesulfonamide
- benzenesulfonamide, 4-fluoro-N-(2-methyl-3-nitrophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.