CAS 612502-28-0
:(2S)-2-phenethylpiperazine
Description:
(2S)-2-phenethylpiperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The "2S" designation indicates that the compound has a specific stereochemistry at the second carbon, which is crucial for its biological activity. This compound features a phenethyl group attached to the piperazine ring, contributing to its lipophilicity and potential interactions with biological targets. It is often studied in the context of pharmacology due to its potential effects on neurotransmitter systems, particularly in relation to serotonin and dopamine receptors. The compound may exhibit various properties, including solubility in organic solvents and moderate stability under standard conditions. Its applications can range from research in neuropharmacology to potential therapeutic uses, although specific biological activities and mechanisms would depend on further empirical studies. As with many piperazine derivatives, (2S)-2-phenethylpiperazine may also serve as a scaffold for the development of new pharmaceuticals.
Formula:C12H18N2
InChI:InChI=1/C12H18N2/c1-2-4-11(5-3-1)6-7-12-10-13-8-9-14-12/h1-5,12-14H,6-10H2/t12-/m0/s1
SMILES:c1ccc(cc1)CC[C@H]1CNCCN1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
