CAS 612511-67-8

1H-1,2,3-Triazole-4-methanamine, 1-methyl-, hydrochloride (1:1)

Description:

1H-1,2,3-Triazole-4-methanamine, 1-methyl-, hydrochloride (1:1) is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This compound is typically used in pharmaceutical and biochemical research due to its potential as a building block in drug development and its ability to act as a ligand in coordination chemistry. The presence of the methyl group enhances its solubility and reactivity, while the hydrochloride salt form improves stability and handling properties. As a hydrochloride, it is often more soluble in water, making it suitable for various applications in biological systems. The compound may exhibit biological activity, including antimicrobial or antifungal properties, which are common in triazole derivatives. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, this compound represents a versatile structure with significant implications in medicinal chemistry and related fields.

Formula: C₄H₈N₄·ClH

InChI: InChI=1S/C4H8N4.ClH/c1-8-3-4(2-5)6-7-8;/h3H,2,5H2,1H3;1H

InChI key: InChIKey=SJIXCYWIWORVHE-UHFFFAOYSA-N

SMILES: C(N)C1=CN(C)N=N1.Cl

Synonyms:

• 1H-1,2,3-Triazole-4-methanamine, 1-methyl-, monohydrochloride
• (1-Methyl-1H-1,2,3-triazol-4-yl)methanamine hydrochloride
• 1H-1,2,3-Triazole-4-methanamine, 1-methyl-, hydrochloride (1:1)

(1-Methyl-1H-1,2,3-triazol-4-yl)methanamine hydrochloride

CAS: 612511-67-8

Versatile small molecule scaffold

Formula: C₄H₉ClN₄

Purity: Min. 95%

Molecular weight: 148.59 g/mol

Ref: 3D-MZA51167