CAS 61259-29-8
:1-cyclohexyl-2-phenyl-1-ethanone
Description:
1-Cyclohexyl-2-phenyl-1-ethanone, with the CAS number 61259-29-8, is an organic compound characterized by its ketone functional group. It features a cyclohexyl group and a phenyl group attached to a central ethanone structure, which contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid with a distinctive aromatic odor. It is relatively non-polar, making it soluble in organic solvents but less soluble in water. The presence of both cyclohexyl and phenyl groups enhances its stability and influences its reactivity, particularly in electrophilic aromatic substitution reactions. Additionally, it may exhibit moderate volatility and can be sensitive to light and heat. Due to its structural characteristics, 1-cyclohexyl-2-phenyl-1-ethanone may find applications in organic synthesis, particularly in the production of various pharmaceuticals and fine chemicals. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C14H18O
InChI:InChI=1/C14H18O/c15-14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1,3-4,7-8,13H,2,5-6,9-11H2
SMILES:c1ccc(cc1)CC(=O)C1CCCCC1
Synonyms:- 1-Cyclohexyl-2-Phenylethanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1-Cyclohexyl-2-phenyl-1-ethanone
CAS:<p>1-Cyclohexyl-2-phenyl-1-ethanone is a serotonergic drug that belongs to the group of arylpiperazines. It has been shown to have therapeutic potential for the treatment of symptoms associated with depression, anxiety, and other mood disorders. 1-Cyclohexyl-2-phenyl-1-ethanone inhibits serotonin reuptake in the brain by binding to the serotonin transporter (SERT) and preventing it from recycling serotonin into the presynaptic neuron. This active form of 1-cyclohexyl-2-phenyl-1 -ethanone can be synthesized by reacting benzylamine derivatives with birefringent crystals in hydrochloric acid. The reaction products are then purified using inorganic acid and polymer film amines. 1C2PE also binds to and inhibits protein kinase C, which is involved in inflammatory processes.</p>Formula:C14H18OPurity:Min. 95%Molecular weight:202.29 g/mol
