CAS 61259-48-1

D-Gluconic acid δ-lactone 2,3,4,6-tetraacetate

Description:

D-Gluconic acid δ-lactone 2,3,4,6-tetraacetate, with the CAS number 61259-48-1, is a derivative of D-gluconic acid, characterized by the presence of a lactone structure and four acetyl groups attached to the hydroxyl positions of the glucose moiety. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and methanol, owing to its polar functional groups. The acetylation of the hydroxyl groups enhances its lipophilicity and stability, making it useful in various chemical applications, including as a reagent in organic synthesis and as a potential intermediate in the production of pharmaceuticals. The lactone form indicates that it can undergo hydrolysis to regenerate D-gluconic acid under appropriate conditions. Additionally, the compound may exhibit biological activity, which can be explored in the context of its potential applications in food chemistry or as a biochemical agent. Overall, D-Gluconic acid δ-lactone 2,3,4,6-tetraacetate is a versatile compound with significant implications in both industrial and research settings.

Formula: C₁₄H₁₈O₁₀

InChI: InChI=1S/C14H18O10/c1-6(15)20-5-10-11(21-7(2)16)12(22-8(3)17)13(14(19)24-10)23-9(4)18/h10-13H,5H2,1-4H3/t10-,11-,12+,13-/m1/s1

InChI key: InChIKey=BWFISYIJSZXAOV-FVCCEPFGSA-N

SMILES: O(C(C)=O)[C@H]1[C@H](OC(C)=O)[C@@H](COC(C)=O)OC(=O)[C@@H]1OC(C)=O

Synonyms:

• D-Gluconic acid, δ-lactone, 2,3,4,6-tetraacetate
• D-Gluconic acid δ-lactone 2,3,4,6-tetraacetate

D-Gluconic acid, δ-lactone, 2,3,4,6-tetraacetate

CAS: 61259-48-1

Formula: C₁₄H₁₈O₁₀

Color and Shape: Solid

Molecular weight: 346.2867

Ref: IN-DA003AO5

Canagliflozin Impurity 70

CAS: 61259-48-1

Formula: C₁₄H₁₈O₁₀

Molecular weight: 346.29

Ref: 4Z-C-152085

2,3,4,6-Tetra-O-acetyl-D-gluconolactone

CAS: 61259-48-1

2,3,4,6-Tetra-O-acetyl-D-gluconolactone is a carbohydrate that is used as an antioxidant. It is an ester of butanol and 2,3,4,6-tetra-O-acetyl-D-gluconic acid and has been shown to have chain transfer properties. This compound is also soluble in organic solvents such as methylene chloride and ethylzinc. 2,3,4,6-Tetra-O-acetyl-D-gluconolactone can be used in the synthesis of a number of different compounds including polyesters and polyamides.

Formula: C₁₄H₁₈O₁₀

Purity: Min. 95%

Color and Shape: White To Off-White Solid

Molecular weight: 346.29 g/mol

Ref: 3D-MT45176