CAS 6126-10-9

1-[(4-methylphenyl)sulfonyl]-1H-pyrazole

Description:

1-[(4-methylphenyl)sulfonyl]-1H-pyrazole, with the CAS number 6126-10-9, is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features a sulfonyl group attached to the pyrazole, specifically a para-methylphenyl group, which enhances its chemical reactivity and solubility properties. It typically appears as a solid at room temperature and is known for its potential applications in pharmaceuticals and agrochemicals due to its biological activity. The presence of the sulfonyl group contributes to its polar nature, influencing its interactions in various chemical environments. Additionally, the methyl group on the phenyl ring can affect the compound's electronic properties and steric hindrance, which may play a role in its reactivity and binding affinity in biological systems. Overall, this compound is of interest in medicinal chemistry for its potential therapeutic applications.

Formula: C₁₀H₁₀N₂O₂S

InChI: InChI=1/C10H10N2O2S/c1-9-3-5-10(6-4-9)15(13,14)12-8-2-7-11-12/h2-8H,1H3

SMILES: Cc1ccc(cc1)S(=O)(=O)n1cccn1

Synonyms:

• 1H-Pyrazole, 1-[(4-methylphenyl)sulfonyl]-
• 1-[(4-Methylphenyl)sulfonyl]-1H-pyrazole

1-tosyl-1H-pyrazole

CAS: 6126-10-9

Formula: C₁₀H₁₀N₂O₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 222.2636

Ref: IN-DA003ENY

1-Tosyl-1H-pyrazole

CAS: 6126-10-9

1-Tosyl-1H-pyrazole

Purity: 98%

Molecular weight: 222.26g/mol

Ref: 54-OR1005362

1-Tosyl-1H-pyrazole

CAS: 6126-10-9

Formula: C₁₀H₁₀N₂O₂S

Purity: 98%

Molecular weight: 222.26

Ref: 10-F338206