CAS 61260-03-5

Ethane-d5-thiol

Description:

Ethane-d5-thiol, also known as 1-thioethane-d5, is a deuterated form of ethyl mercaptan, characterized by the presence of five deuterium atoms replacing hydrogen in the ethane molecule. Its molecular formula is C2H5D5S, and it features a thiol functional group (-SH), which imparts distinctive properties typical of thiols, such as a strong, often unpleasant odor reminiscent of rotten cabbage or garlic. Ethane-d5-thiol is a colorless liquid at room temperature and is soluble in organic solvents. The presence of deuterium makes it useful in various applications, particularly in studies involving nuclear magnetic resonance (NMR) spectroscopy, where it serves as a tracer or internal standard due to its unique spectral characteristics. Additionally, its deuterated nature can enhance the stability and reactivity of certain chemical reactions, making it valuable in synthetic organic chemistry. As with other thiols, it is important to handle ethane-d5-thiol with care due to its potential toxicity and strong odor.

Formula: C₂HD₅S

InChI: InChI=1S/C2H6S/c1-2-3/h3H,2H2,1H3/i1D3,2D2

InChI key: InChIKey=DNJIEGIFACGWOD-ZBJDZAJPSA-N

SMILES: C(C([2H])([2H])[2H])(S)([2H])[2H]

Synonyms:

• Ethane-d5-thiol

Ethane-d5-thiol

CAS: 61260-03-5

Formula: CD₃CD₂SH

Purity: 98 atom % D

Color and Shape: Colorless Low-Boiling Liquid

Molecular weight: 67.05041

Ref: 3U-D0492

Ethane-d5-thiol

Controlled Product

CAS: 61260-03-5

Applications Ethane-d5-thiol (CAS# 61260-03-5) is a useful isotopically labeled research compound.

Formula: C₂D₅HS

Color and Shape: Neat

Molecular weight: 67.165

Ref: TR-E676471