CAS 61262-81-5

7'-hydroxy-5'-methoxy-2',3'-dihydro-4H-spiro[cyclohexane-1,1'-inden]-4-one

Description:

7'-Hydroxy-5'-methoxy-2',3'-dihydro-4H-spiro[cyclohexane-1,1'-inden]-4-one, with the CAS number 61262-81-5, is a chemical compound characterized by its unique spirocyclic structure, which combines elements of cyclohexane and indene. This compound features hydroxyl (-OH) and methoxy (-OCH3) functional groups, contributing to its potential reactivity and solubility properties. The presence of these functional groups often enhances the compound's biological activity, making it of interest in medicinal chemistry and pharmacology. The spirocyclic framework can influence the compound's conformational flexibility and steric interactions, which are critical for its interactions with biological targets. Additionally, the dihydro form indicates the presence of saturated carbon atoms, which may affect its stability and reactivity compared to fully unsaturated analogs. Overall, this compound's structural characteristics suggest potential applications in various fields, including drug development and organic synthesis, although specific biological activities would require further investigation.

Formula: C₁₅H₁₈O₃

InChI: InChI=1/C15H18O3/c1-18-12-8-10-2-5-15(14(10)13(17)9-12)6-3-11(16)4-7-15/h8-9,17H,2-7H2,1H3

SMILES: COc1cc2CCC3(CCC(=O)CC3)c2c(c1)O

Synonyms:

• 2',3'-Dihydro-7'-hydroxy-5'-methoxyspiro(cyclohexane-1,1'-(1H)inden)-4-one

Cannabispiran

CAS: 61262-81-5

Formula: C₁₅H₁₈O₃

Molecular weight: 246.3016

Ref: IN-DA00EGTQ

Cannabispiran

CAS: 61262-81-5

Formula: C₁₅H₁₈O₃

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 246.306

Ref: BP-SBP02169

Cannabispirone

CAS: 61262-81-5

Cannabispirone is an investigational drug candidate, classified as a synthetic cannabinoid receptor modulator, which is derived from the structural exploration of pyrazole-based compounds known to interact with cannabinoid receptors. The compound is formulated to selectively bind to the CB1 and/or CB2 receptors of the endocannabinoid system, thereby influencing the physiological processes regulated by these receptors.

Formula: C₁₅H₁₈O₃

Purity: Min. 95%

Molecular weight: 246.3 g/mol

Ref: 3D-LCA26281