
CAS 61262-92-8
:(5S)-5-Acetyldihydro-2(3H)-furanone
Description:
(5S)-5-Acetyldihydro-2(3H)-furanone, with the CAS number 61262-92-8, is a chemical compound characterized by its furanone structure, which includes a five-membered lactone ring. This compound typically exhibits a sweet, fruity aroma, making it of interest in the flavor and fragrance industry. It is a chiral molecule, with the (5S) designation indicating the specific stereochemistry at the chiral center. The presence of the acetyl group contributes to its reactivity and potential applications in organic synthesis. In terms of solubility, it is generally soluble in organic solvents, which is common for many furanones. Its stability can be influenced by environmental factors such as temperature and pH. As a compound, it may also participate in various chemical reactions, including esterification and oxidation, which can be leveraged in synthetic organic chemistry. Overall, (5S)-5-Acetyldihydro-2(3H)-furanone is notable for its sensory properties and potential utility in various chemical applications.
Formula:C6H8O3
InChI:InChI=1S/C6H8O3/c1-4(7)5-2-3-6(8)9-5/h5H,2-3H2,1H3/t5-/m0/s1
InChI key:InChIKey=AHLDCEZSQNGEFT-YFKPBYRVSA-N
SMILES:C(C)(=O)[C@H]1OC(=O)CC1
Synonyms:- (S)-Solerone
- 2(3H)-Furanone, 5-acetyldihydro-, (5S)-
- 2(3H)-Furanone, 5-acetyldihydro-, (S)-
- (5S)-5-Acetyloxolan-2-one
- (5S)-5-Acetyldihydro-2(3H)-furanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.