CAS 61278-38-4
:Disialyllacto-N-tetraose
Description:
Disialyllacto-N-tetraose is a complex carbohydrate, specifically a type of oligosaccharide, that consists of a chain of sugar units. It is characterized by the presence of two sialic acid residues, which are negatively charged and contribute to the molecule's overall properties, including its solubility and interaction with biological systems. This oligosaccharide is derived from lactose and is part of the larger family of glycans, which play crucial roles in cellular recognition, signaling, and immune response. Disialyllacto-N-tetraose is often found in human milk and is believed to have prebiotic effects, promoting the growth of beneficial gut bacteria. Its structure includes a combination of galactose, glucose, and N-acetylglucosamine units, linked together in a specific arrangement that influences its biological activity. The presence of sialic acid also enhances its stability and resistance to enzymatic degradation, making it an important component in various biological processes. Overall, Disialyllacto-N-tetraose exemplifies the complexity and functionality of glycan structures in biological systems.
Formula:C48H79N3O37
InChI:InChI=1S/C48H79N3O37/c1-13(58)49-25-16(61)4-47(45(75)76,86-38(25)29(68)19(64)7-53)79-12-24-33(72)37(27(51-15(3)60)42(82-24)85-40-31(70)22(10-56)80-43(34(40)73)83-36(21(66)9-55)28(67)18(63)6-52)84-44-35(74)41(32(71)23(11-57)81-44)88-48(46(77)78)5-17(62)26(50-14(2)59)39(87-48)30(69)20(65)8-54/h6,16-44,53-57,61-74H,4-5,7-12H2,1-3H3,(H,49,58)(H,50,59)(H,51,60)(H,75,76)(H,77,78)/t16-,17-,18-,19+,20+,21+,22+,23+,24+,25+,26+,27+,28+,29+,30+,31-,32-,33+,34+,35+,36+,37+,38+,39+,40-,41-,42-,43-,44-,47+,48-/m0/s1
InChI key:InChIKey=BTDPEAPRLHRFIA-VYZFFVDYSA-N
SMILES:O([C@@]1(C(O)=O)O[C@@]([C@@H]([C@@H](CO)O)O)([C@H](NC(C)=O)[C@@H](O)C1)[H])[C@@H]2[C@@H](O)[C@H](O[C@@H]3[C@@H](NC(C)=O)[C@H](O[C@@H]4[C@@H](O)[C@H](O[C@@H]([C@@H]([C@H](C=O)O)O)[C@@H](CO)O)O[C@H](CO)[C@@H]4O)O[C@H](CO[C@@]5(C(O)=O)O[C@@]([C@@H]([C@@H](CO)O)O)([C@H](NC(C)=O)[C@@H](O)C5)[H])[C@H]3O)O[C@H](CO)[C@@H]2O
Synonyms:- <span class="text-smallcaps">D</smallcap>-Glucose, O-(N-acetyl-α-neuraminosyl)-(2→6)-O-[O-(N-acetyl-α-neuraminosyl)-(2→3)-β-<smallcap>D</smallcap>-galactopyranosyl-(1→3)]-O-2-(acetylamino)-2-deoxy-β-<smallcap>D</smallcap>-glucopyranosyl-(1→3)-O-β-<smallcap>D</span>-galactopyranosyl-(1→4)-
- Di-N-Acetylneuraminosyllacto-N-tetraose
- Disialyllacto-N-tetraose
- Disialyllacto-N-tetraose, Disodium Salt, Human Milk
- O-(N-Acetyl-α-neuraminosyl)-(2→6)-O-[O-(N-acetyl-α-neuraminosyl)-(2→3)-β-<span class="text-smallcaps">D</smallcap>-galactopyranosyl-(1→3)]-O-2-(acetylamino)-2-deoxy-β-<smallcap>D</smallcap>-glucopyranosyl-(1→3)-O-β-<smallcap>D</smallcap>-galactopyranosyl-(1→4)-<smallcap>D</span>-glucose
- D-Glucose, O-(N-acetyl-α-neuraminosyl)-(2→6)-O-[O-(N-acetyl-α-neuraminosyl)-(2→3)-β-D-galactopyranosyl-(1→3)]-O-2-(acetylamino)-2-deoxy-β-D-glucopyranosyl-(1→3)-O-β-D-galactopyranosyl-(1→4)-
- O-(N-Acetyl-α-neuraminosyl)-(2→6)-O-[O-(N-acetyl-α-neuraminosyl)-(2→3)-β-D-galactopyranosyl-(1→3)]-O-2-(acetylamino)-2-deoxy-β-D-glucopyranosyl-(1→3)-O-β-D-galactopyranosyl-(1→4)-D-glucose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Disialyllacto-N-tetraose
CAS:Formula:C48H79N3O37Purity:≥ 90%Color and Shape:White to off-white solidMolecular weight:1290.16Disialyllacto-N-tetraose
CAS:<p>Disialyllacto-N-tetraose is a medicinal compound that has shown promising anticancer properties. It is an analog of a human urinary glycoprotein and has been found to induce apoptosis in cancer cells. Disialyllacto-N-tetraose acts as a tumor inhibitor by blocking the activity of certain protein kinases, which are enzymes that play a role in cell growth and division. This compound has been studied extensively in Chinese medicine and has shown potential as an effective anticancer agent. Its unique structure and mechanism of action make it a promising candidate for further research into cancer treatment.</p>Formula:C48H79N3O37Purity:Min. 85%Molecular weight:1,290.16 g/mol

