CAS 612848-74-5
:1-(4-{[4-(2-oxo-2,3-dihydro-1H-benzimidazol-1-yl)piperidin-1-yl]methyl}phenyl)-2-phenylethane-1,2-dione
Description:
The chemical substance known as 1-(4-{[4-(2-oxo-2,3-dihydro-1H-benzimidazol-1-yl)piperidin-1-yl]methyl}phenyl)-2-phenylethane-1,2-dione, with the CAS number 612848-74-5, is a complex organic compound characterized by its multi-functional structure. It features a benzimidazole moiety, which is known for its biological activity, particularly in medicinal chemistry. The presence of a piperidine ring contributes to its potential pharmacological properties, while the phenyl and diketone groups enhance its reactivity and solubility in various solvents. This compound may exhibit properties such as antioxidant, anti-inflammatory, or anticancer activities, making it of interest in drug development. Its molecular structure suggests potential interactions with biological targets, which could lead to therapeutic applications. However, detailed studies on its specific biological effects, toxicity, and pharmacokinetics would be necessary to fully understand its potential uses in medicine or other fields. As with many synthetic compounds, proper handling and safety measures should be observed due to the complexity of its structure and potential reactivity.
Formula:C27H25N3O3
InChI:InChI=1/C27H25N3O3/c31-25(20-6-2-1-3-7-20)26(32)21-12-10-19(11-13-21)18-29-16-14-22(15-17-29)30-24-9-5-4-8-23(24)28-27(30)33/h1-13,22H,14-18H2,(H,28,33)
SMILES:c1ccc(cc1)C(=O)C(=O)c1ccc(cc1)CN1CCC(CC1)n1c2ccccc2nc1O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

