CAS 61292-08-8

4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide

Description:

4-Methyl-2-phenyl-1,3-thiazole-5-carbohydrazide is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a methyl group and a phenyl group, contributing to its unique chemical properties and potential biological activities. The presence of the carbohydrazide functional group suggests that it may exhibit hydrazone reactivity, which can be significant in various chemical reactions, including those involving condensation and complex formation. The thiazole moiety is known for its role in pharmaceuticals and agrochemicals, often associated with antimicrobial and anti-inflammatory properties. Additionally, the compound's structure may allow for interactions with biological targets, making it of interest in medicinal chemistry. Its CAS number, 61292-08-8, provides a unique identifier for regulatory and research purposes. Overall, 4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide represents a compound with potential applications in various fields, including drug development and material science.

Formula: C₁₁H₁₁N₃OS

InChI: InChI=1/C11H11N3OS/c1-7-9(10(15)14-12)16-11(13-7)8-5-3-2-4-6-8/h2-6H,12H2,1H3,(H,14,15)

SMILES: Cc1c(C(=NN)O)sc(c2ccccc2)n1

Synonyms:

• 5-Thiazolecarboxylic Acid, 4-Methyl-2-Phenyl-, Hydrazide
• 4-METHYL-2-PHENYL-1,3-THIAZOLE-5-CARBOHYDRAZIDE

4-Methyl-2-phenyl-1,3-thiazole-5-carbohydrazide

CAS: 61292-08-8

4-Methyl-2-phenyl-1,3-thiazole-5-carbohydrazide

Purity: ≥95%

Molecular weight: 233.29g/mol

Ref: 54-OR72080

4-Methyl-2-phenyl-thiazole-5-carboxylic acid hydrazide

CAS: 61292-08-8

Formula: C₁₁H₁₁N₃OS

Purity: 95.0%

Molecular weight: 233.29

Ref: 10-F511152

4-Methyl-2-phenylthiazole-5-carboxylic acid hydrazide

CAS: 61292-08-8

4-Methyl-2-phenylthiazole-5-carboxylic acid hydrazide is a potent anticancer agent. It has been shown to inhibit the growth of cancer cells through inhibition of DNA synthesis and protein synthesis, as well as by inducing apoptosis. 4-Methyl-2-phenylthiazole-5-carboxylic acid hydrazide binds to the active site of DNA gyrase, an enzyme that maintains the integrity of bacterial DNA. This binding prevents the formation of an antibiotic-inhibitor complex with the enzyme cell wall synthesis that is required for cell wall biosynthesis, inhibiting protein synthesis and cell division. The antitumor activity was found to be mediated through interactions with pharmacological targets such as butanamide, phenacyl, dioxane, and chlorides. These drugs bind to pharmacophores on tumor cells and are able to penetrate into tumor cells more easily than other drugs. The potent anticancer

Formula: C₁₁H₁₁N₃OS

Purity: Min. 95%

Molecular weight: 233.29 g/mol

Ref: 3D-LCA29208