CAS 61292-08-8: 4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide
Description:4-Methyl-2-phenyl-1,3-thiazole-5-carbohydrazide is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a methyl group and a phenyl group, contributing to its unique chemical properties and potential biological activities. The presence of the carbohydrazide functional group suggests that it may exhibit hydrazone reactivity, which can be significant in various chemical reactions, including those involving condensation and complex formation. The thiazole moiety is known for its role in pharmaceuticals and agrochemicals, often associated with antimicrobial and anti-inflammatory properties. Additionally, the compound's structure may allow for interactions with biological targets, making it of interest in medicinal chemistry. Its CAS number, 61292-08-8, provides a unique identifier for regulatory and research purposes. Overall, 4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide represents a compound with potential applications in various fields, including drug development and material science.
Formula:C11H11N3OS
InChI:InChI=1/C11H11N3OS/c1-7-9(10(15)14-12)16-11(13-7)8-5-3-2-4-6-8/h2-6H,12H2,1H3,(H,14,15)
- Synonyms:
- 5-Thiazolecarboxylic Acid, 4-Methyl-2-Phenyl-, Hydrazide
- 4-METHYL-2-PHENYL-1,3-THIAZOLE-5-CARBOHYDRAZIDE

4-Methyl-2-phenyl-thiazole-5-carboxylic acid hydrazide
Ref: 10-F511152
1g | 152.00 € |

Ref: 54-OR72080
1g | 93.00 € | ||
5g | 286.00 € |

4-Methyl-2-phenylthiazole-5-carboxylic acid hydrazide
Ref: 3D-LCA29208
2500mg | 378.00 € |