CAS 613-03-6
:1,2,4-Triacetoxybenzene
Description:
1,2,4-Triacetoxybenzene, with the CAS number 613-03-6, is an organic compound characterized by the presence of three acetoxy groups attached to a benzene ring at the 1, 2, and 4 positions. This compound is a derivative of benzene, where the hydrogen atoms are replaced by acetoxy groups, which are functional groups derived from acetic acid. It typically appears as a crystalline solid and is soluble in organic solvents. The presence of multiple acetoxy groups enhances its reactivity, making it useful in various chemical synthesis processes, including the production of other organic compounds. Additionally, 1,2,4-triacetoxybenzene can exhibit interesting properties such as potential antimicrobial activity and may serve as a precursor in the synthesis of more complex molecules. Its chemical structure contributes to its stability and reactivity, making it a valuable compound in organic chemistry and industrial applications. Safety precautions should be observed when handling this substance, as with many organic compounds, due to potential health hazards.
Formula:C12H12O6
InChI:InChI=1S/C12H12O6/c1-7(13)16-10-4-5-11(17-8(2)14)12(6-10)18-9(3)15/h4-6H,1-3H3
InChI key:InChIKey=AESFGSJWSUZRGW-UHFFFAOYSA-N
SMILES:O(C(C)=O)C1=C(OC(C)=O)C=CC(OC(C)=O)=C1
Synonyms:- (3,4-Diacetyloxyphenyl) acetate
- 1,2,4-Benzenetriol, 1,2,4-triacetate
- 1,2,4-Benzenetriol, triacetate
- 1,2,4-Phenenyl triacetate
- 1,2,4-Tris(acetoxy)benzene
- 2,4-Bis(acetyloxy)phenyl acetate
- 2,5-Bis(acetyloxy)phenyl acetate
- 2-Hydroxyhydroquinone triacetate
- 2-[(1-Hydroxyethenyl)Oxy]Benzene-1,4-Diyl Diacetate
- Benzene-1,2,4-Triyl Triacetate
- Hydroxyhydroquinone triacetate
- NSC 2149
- Pyrogallol A
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1,2,4-Triacetoxybenzene
CAS:Formula:C12H12O6Purity:>95.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:252.22Benzene-1,2,4-triyl triacetate
CAS:Formula:C12H12O6Purity:%Color and Shape:SolidMolecular weight:252.22011,2,4-Triacetoxybenzene
CAS:1,2,4-Triacetoxybenzene is a chemical that belongs to the group of halogenated aromatic compounds. It is used as a precursor for the production of pharmaceuticals and agrochemicals. The compound can be synthesized by reacting 1,2-dichlorobenzene with acetic acid, followed by hydrolysis with hydrochloric acid. When heated in the presence of hydrogen chloride, 1,2-dichlorobenzene reacts with acetic acid to form 1,2-dichloroethane and acetyl chloride.Formula:C12H12O6Purity:Min. 97 Area-%Color and Shape:White PowderMolecular weight:252.22 g/mol1,2,4-Triacetoxybenzene
CAS:Controlled ProductApplications 1,2,4-Triacetoxybenzene, can be used in preparation of two marine aminated hydroxynaphthazarins, echinamines A and B.
References Pokhilo N. D., et al.: Journal of natural products, 69(8), undefined (2006-8-29);Formula:C12H12O6Color and Shape:NeatMolecular weight:252.22





