CAS 613-12-7
:2-Methylanthracene
Description:
2-Methylanthracene is an organic compound belonging to the polycyclic aromatic hydrocarbon (PAH) family. It is characterized by a fused ring structure consisting of three benzene rings, with a methyl group attached to the second carbon of the anthracene framework. This compound is typically a solid at room temperature and exhibits a crystalline appearance. It is known for its fluorescent properties, making it useful in various applications, including organic electronics and as a fluorescent probe in scientific research. 2-Methylanthracene is relatively insoluble in water but soluble in organic solvents such as benzene and toluene. It has a melting point that is higher than that of anthracene, reflecting its increased molecular complexity. Additionally, like other PAHs, it is important to handle 2-methylanthracene with care due to potential health risks associated with exposure, including carcinogenicity. Its chemical formula is C15H12, and it is often studied for its reactivity and behavior in various chemical environments.
Formula:C15H12
InChI:InChI=1S/C15H12/c1-11-6-7-14-9-12-4-2-3-5-13(12)10-15(14)8-11/h2-10H,1H3
InChI key:InChIKey=GYMFBYTZOGMSQJ-UHFFFAOYSA-N
SMILES:CC1=CC2=C(C=C3C(=C2)C=CC=C3)C=C1
Synonyms:- 2-Methylanthracen
- 2-Metilantraceno
- Anthracene, 2-methyl-
- Ccris 2739
- Nsc 87376
- 2-Methylanthracene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Methylanthracene
CAS:2-Methylanthracene is a diazonium salt that inhibits the growth of bacteria by binding to DNA, thereby preventing transcription and replication. 2-Methylanthracene has an inhibitory effect at pH 6.0 but no inhibitory effect at pH 8.0 due to its solubility data. The aromatic hydrocarbon is soluble in water and has a solute concentration of 1.5 g/L at pH 6.0 and 5 g/L at pH 8.0. 2-Methylanthracene binds to the DNA of bacteria in cell culture through steric interactions with the hydrophobic aromatic rings, inhibiting bacterial growth and causing cell death by interfering with protein synthesis and DNA replication.Formula:C15H12Purity:Min. 95%Color and Shape:Off-White PowderMolecular weight:192.26 g/mol
