CAS 613-26-3
:2,6-Dimethylanthracene
Description:
2,6-Dimethylanthracene is an organic compound belonging to the polycyclic aromatic hydrocarbon (PAH) family. It features a fused three-ring structure, characteristic of anthracene, with two methyl groups attached at the 2 and 6 positions. This compound is typically a solid at room temperature, exhibiting a crystalline form with a distinct blue fluorescence under ultraviolet light. It is relatively insoluble in water but soluble in organic solvents such as benzene and toluene. 2,6-Dimethylanthracene is known for its stability and resistance to oxidation, making it useful in various applications, including organic electronics and as a fluorescent probe in chemical research. Additionally, it has been studied for its potential role in photophysical processes and as a model compound in environmental studies due to its presence in combustion products. However, like many PAHs, it may pose environmental and health risks, necessitating careful handling and disposal.
Formula:C16H14
InChI:InChI=1S/C16H14/c1-11-3-5-13-10-16-8-12(2)4-6-14(16)9-15(13)7-11/h3-10H,1-2H3
InChI key:InChIKey=AYRABHFHMLXKBT-UHFFFAOYSA-N
SMILES:CC1=CC2=C(C=C3C(=C2)C=CC(C)=C3)C=C1
Synonyms:- 2,6-Dimethylanthracene
- Anthracene, 2,6-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,6-Dimethylanthracene
CAS:Controlled Product<p>Applications 2,6-Dimethylanthracene (cas# 613-26-3) is a compound useful in organic synthesis.<br></p>Formula:C16H14Color and Shape:NeatMolecular weight:206.28
