CAS 613-93-4
:N-Methylbenzamide
Description:
N-Methylbenzamide is an organic compound characterized by its amide functional group, where a methyl group is attached to the nitrogen atom of the benzamide structure. It has the molecular formula C9H11NO, indicating the presence of nine carbon atoms, eleven hydrogen atoms, one nitrogen atom, and one oxygen atom. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature. N-Methylbenzamide is known for its moderate solubility in water and good solubility in organic solvents, which makes it useful in various chemical applications. It has a relatively low melting point and boiling point compared to many other organic compounds, reflecting its relatively low molecular weight. N-Methylbenzamide is often utilized in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. Additionally, it may exhibit properties such as being a potential solvent or reagent in chemical reactions. As with many amides, it can participate in hydrogen bonding, influencing its physical properties and reactivity.
Formula:C8H9NO
InChI:InChI=1S/C8H9NO/c1-9-8(10)7-5-3-2-4-6-7/h2-6H,1H3,(H,9,10)
InChI key:InChIKey=NCCHARWOCKOHIH-UHFFFAOYSA-N
SMILES:C(NC)(=O)C1=CC=CC=C1
Synonyms:- Ai3-01069
- Benzamide, N-methyl-
- Brn 1209880
- Ccris 4670
- N-Methylbenzenamide
- N-Methylbenzenecarboxamide
- Nsc 42944
- N-Methylbenzamide
- 4-09-00-00727 (Beilstein Handbook Reference)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
N-Methylbenzamide, 99%
CAS:It acts as a potent PDE10A (phosphodiesterase with a remarkable localization as the protein is abundant only in brain tissue) inhibitor. It is also employed as a pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. SomeFormula:C8H9NOPurity:99%Color and Shape:White to pale cream, Crystals or powder or crystalline powderMolecular weight:135.17N-Methylbenzamide
CAS:N-Methylbenzamide is a potent phosphodiesterase 10A (PDE10A) inhibitor,with anti-cancer activity.Formula:C8H9NOPurity:99.83%Color and Shape:Physical Description Off-White Crystalline Solid (Ntp 1992)Molecular weight:135.16N-Methylbenzamide
CAS:Formula:C8H9NOPurity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:135.17N-Methylbenzamide
CAS:N-Methylbenzamide is a hydrogen bond donor that participates in the transfer of a proton. It contains an amine group, which is highly reactive and can form hydrogen bonds with other molecules. The thermodynamic stability of N-methylbenzamide is due to the dihedral angle between the amine group and carbonyl group. This molecule has been shown to undergo asymmetric synthesis, which allows for the creation of enantiomers. N-Methylbenzamide has been used as a chiral auxiliary in chromatographic science to separate amino acids by using different solvents. N-Methylbenzamide has also been shown to react with sodium carbonate and water molecules, leading to the formation of an amide bond.
Formula:C6H5CONHCH3Purity:Min. 95%Molecular weight:135.16 g/mol






