CAS 6131-98-2
:butanedioate, 2,3-dihydroxy-, monosodium salt, monohydrate
Description:
Butanedioate, 2,3-dihydroxy-, monosodium salt, monohydrate, commonly known as sodium 2,3-dihydroxybutanedioate, is a chemical compound characterized by its sodium salt form of a dicarboxylic acid. It features two hydroxyl groups and is derived from butanedioic acid (succinic acid). This compound typically appears as a white crystalline solid and is soluble in water, which is a characteristic trait of many sodium salts. The presence of hydroxyl groups contributes to its potential as a chelating agent and its ability to participate in various biochemical reactions. It is often used in biochemical applications, including as a buffer or stabilizing agent in laboratory settings. The monohydrate form indicates that it contains one molecule of water for each molecule of the salt, which can influence its stability and solubility. Overall, this compound plays a role in various chemical and biological processes, making it relevant in both research and industrial applications.
Formula:C4H6NaO7
InChI:InChI=1/C4H6O6.Na.H2O/c5-1(3(7)8)2(6)4(9)10;;/h1-2,5-6H,(H,7,8)(H,9,10);;1H2/q;+1;/p-2
Synonyms:- Butanedioate, 2,3-Dihydroxy-, Sodium Salt, Hydrate (1:1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Butanedioic acid, 2,3-dihydroxy- [R-(R*,R*)]-, monosodium salt,monohydrate
CAS:Formula:C4H8NaO7Purity:99%Color and Shape:SolidMolecular weight:191.0919Sodium Bitartrate Monohydrate
CAS:Sodium Bitartrate MonohydratePurity:98%Molecular weight:190.08g/molL-Tartaric acid sodium hydrate
CAS:L-Tartaric acid sodium hydrate is a white plant-derived dicarboxylic acid used in food and wine, reacts with sodium bicarbonate.Formula:C4H7NaO7Color and Shape:SolidMolecular weight:190.08Sodium Bitartrate Monohydrate
CAS:Controlled ProductApplications Sodium Bitartrate Monohydrate (cas# 6131-98-2) is a compound useful in organic synthesis.
Formula:C4H5O6·Na·H2OColor and Shape:White To Light BeigeMolecular weight:190.084Sodium bitartrate monohydrate
CAS:Sodium bitartrate monohydrate is a white crystalline powder that is soluble in water. This compound is an effervescent agent, which means it produces a large amount of carbon dioxide when dissolved in water. Sodium bitartrate monohydrate has antiviral properties and can be used as an ingredient in pharmaceutical preparations to treat viruses such as herpes simplex virus type 1 (HSV-1). It also has the ability to bind to metals, including aluminium, iron, and zinc. Sodium bitartrate monohydrate can be found in some metal chelate drugs that are used for radiation therapy.
Formula:C4H6O6•H2O•NaPurity:Min. 95%Molecular weight:191.08 g/mol





