CAS 61315-61-5
:N(alpha)-boc-N(omega)-tosyl-D-arginine
Description:
N(alpha)-Boc-N(omega)-tosyl-D-arginine is a derivative of the amino acid arginine, characterized by the presence of a tert-butyloxycarbonyl (Boc) protecting group at the alpha amino group and a tosyl (p-toluenesulfonyl) group at the omega amino group. This compound is typically used in peptide synthesis and as a building block in the development of various bioactive molecules. The Boc group serves to protect the amino group during chemical reactions, while the tosyl group can facilitate further modifications or coupling reactions. The D-arginine configuration indicates that this compound is the D-enantiomer of arginine, which can exhibit different biological activities compared to its L-counterpart. N(alpha)-Boc-N(omega)-tosyl-D-arginine is soluble in organic solvents and may have limited solubility in water, making it suitable for various organic synthesis applications. Its structural features contribute to its utility in the synthesis of peptides and other complex organic molecules, particularly in the field of medicinal chemistry and drug development.
Formula:C18H28N4O6S
InChI:InChI=1/C18H28N4O6S/c1-12-7-9-13(10-8-12)29(26,27)22-16(19)20-11-5-6-14(15(23)24)21-17(25)28-18(2,3)4/h7-10,14H,5-6,11H2,1-4H3,(H,21,25)(H,23,24)(H3,19,20,22)/t14-/m1/s1
SMILES:Cc1ccc(cc1)S(=O)(=O)NC(=N)NCCC[C@H](C(=O)O)N=C(O)OC(C)(C)C
Synonyms:- Boc-D-Arg(Tos)-OH
- (2R)-2-(tert-butoxycarbonylamino)-5-[(N-(p-tolylsulfonyl)carbamimidoyl)amino]pentanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Boc-D-Arg(Tos)-OH
CAS:Boc-D-Arg(Tos)-OH is an analytical grade building block for the synthesis of D-amino acids. It is used as a reagent for the synthesis of Boc-protected D-amino acids and as a precursor to other amino acid derivatives. The chemical name is N-[2,6-diaminopimeloyl]glycine ethyl ester hydrochloride. Boc-D-Arg(Tos)-OH is soluble in ethyl acetate and methanol, but not in water or ethanol. This product can be used to synthesize peptides with desired properties.
Formula:C18H28N4O6SPurity:Min. 95%Molecular weight:428.5 g/mol



