CAS 61318-91-0: sulconazole nitrate
Description:Sulconazole nitrate is an antifungal agent primarily used in the treatment of dermatological infections, particularly those caused by fungi and yeast. It belongs to the class of imidazole derivatives, which are known for their ability to inhibit the synthesis of ergosterol, a critical component of fungal cell membranes. This mechanism disrupts the integrity of the fungal cell, leading to cell death. Sulconazole nitrate is typically formulated as a topical cream or solution, allowing for localized treatment with minimal systemic absorption. The compound is characterized by its relatively low solubility in water, which enhances its efficacy in topical applications. Additionally, it exhibits a broad spectrum of antifungal activity against various pathogens, making it a valuable option in clinical settings. Safety profiles indicate that it is generally well-tolerated, with side effects being rare and typically mild. As with any medication, it is essential to use sulconazole nitrate as directed by a healthcare professional to ensure optimal therapeutic outcomes and minimize the risk of resistance development.
Formula:C18H15Cl3N2S.HNO3
InChI:InChI=1S/C18H15Cl3N2S.HNO3/c19-14-3-1-13(2-4-14)11-24-18(10-23-8-7-22-12-23)16-6-5-15(20)9-17(16)21;2-1(3)4/h1-9,12,18H,10-11H2;(H,2,3,4)
InChI key:InChIKey=CRKGMGQUHDNAPB-UHFFFAOYSA-N
SMILES:O=N(=O)O.ClC1=CC=C(C=C1)CSC(C2=CC=C(Cl)C=C2Cl)CN3C=NC=C3
- Synonyms:
- 1-[2-(4-Chlorobenzylthio)-2-(2,4-dichlorophenyl)ethyl]-1H-imidazole nitrate
- 1H-Imidazole, 1-[2-[[(4-chlorophenyl)methyl]thio]-2-(2,4-dichlorophenyl)ethyl]-, (±)-, mononitrate
- 1H-Imidazole, 1-[2-[[(4-chlorophenyl)methyl]thio]-2-(2,4-dichlorophenyl)ethyl]-, nitrate (1:1)
- Exelderm
- Rs 44872
- Rs 44872-00-10-3
- Sulcosyn
