CAS 61320-20-5

4-(3,5-dimethylpyrazol-1-yl)benzenesulfonyl chloride

Description:

4-(3,5-Dimethylpyrazol-1-yl)benzenesulfonyl chloride, with the CAS number 61320-20-5, is an organic compound characterized by the presence of a sulfonyl chloride functional group attached to a benzene ring, which is further substituted with a 3,5-dimethylpyrazole moiety. This compound typically appears as a solid or crystalline substance and is known for its reactivity, particularly due to the sulfonyl chloride group, which can undergo nucleophilic substitution reactions. It is often utilized in organic synthesis as a sulfonylating agent, facilitating the introduction of sulfonyl groups into various substrates. The presence of the dimethylpyrazole group may impart specific biological activities or enhance solubility in certain solvents. Additionally, this compound should be handled with care due to its potential to release hydrochloric acid upon hydrolysis, making it corrosive and hazardous. Proper safety precautions, including the use of personal protective equipment, are essential when working with this chemical.

Formula: C₁₁H₁₁ClN₂O₂S

InChI: InChI=1/C11H11ClN2O2S/c1-8-7-9(2)14(13-8)10-3-5-11(6-4-10)17(12,15)16/h3-7H,1-2H3

SMILES: Cc1cc(C)n(c2ccc(cc2)S(=O)(=O)Cl)n1

4-(3,5-Dimethyl-1H-pyrazol-1-yl)benzenesulphonyl chloride

CAS: 61320-20-5

4-(3,5-Dimethyl-1H-pyrazol-1-yl)benzenesulphonyl chloride

Purity: ≥95%

Color and Shape: White Solid

Molecular weight: 270.74g/mol

Ref: 54-OR17844

4-(3,5-dimethyl-1H-pyrazol-1-yl)benzenesulfonyl chloride

CAS: 61320-20-5

Color and Shape: Solid

Molecular weight: 270.7300109863281

Ref: 10-F542428