CAS 61323-17-9

2-Bromo-1,8-naphthyridine

Description:

2-Bromo-1,8-naphthyridine is a heterocyclic organic compound characterized by the presence of a bromine atom and a naphthyridine structure, which consists of a fused bicyclic system containing nitrogen atoms. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as ethanol and dimethyl sulfoxide, but has limited solubility in water. The presence of the bromine atom enhances its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. 2-Bromo-1,8-naphthyridine is often utilized in medicinal chemistry and material science due to its potential biological activity and ability to serve as a building block for the synthesis of more complex molecules. Its nitrogen-containing structure can contribute to various pharmacological properties, making it a subject of interest in drug development. As with many halogenated compounds, appropriate safety measures should be taken when handling this substance due to its potential toxicity and environmental impact.

Formula: C₈H₅BrN₂

InChI: InChI=1/C8H5BrN2/c9-7-4-3-6-2-1-5-10-8(6)11-7/h1-5H

SMILES: c1cc2ccc(Br)nc2nc1

Synonyms:

• 1,8-Naphthyridine, 2-Bromo-
• 2-Bromo-1,8-naphthyridine

2-Bromo-1,8-naphthyridine

CAS: 61323-17-9

Formula: C₈H₅BrN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 209.0427

Ref: IN-DA00E97V

2-Bromo-1,8-naphthyridine

CAS: 61323-17-9

2-Bromo-1,8-naphthyridine

Purity: 95%

Molecular weight: 209.04g/mol

Ref: 54-OR17682

2-Bromo-1,8-naphthyridine

CAS: 61323-17-9

Purity: 98%

Molecular weight: 209.0460052

Ref: 10-F653235

2-Bromo-1,8-naphthyridine

CAS: 61323-17-9

2-Bromo-1,8-naphthyridine (2BN) is a synthetic compound that has been shown to inhibit the replication of HIV. It inhibits viral entry into the cell by binding to CD4 receptors on the cell surface, blocking viral attachment and entry. 2BN has been shown to bind to human serum albumin (HSA), which may be responsible for its high detection sensitivity. In addition, 2BN is stable in pharmaceutical formulations and has a short reaction time.

Formula: C₈H₅BrN₂

Purity: Min. 95%

Molecular weight: 209.04 g/mol

Ref: 3D-FB148581