CAS 61328-41-4
:Neoschaftoside
Description:
Neoschaftoside, with the CAS number 61328-41-4, is a chemical compound that belongs to the class of flavonoids, specifically glycosides. It is derived from the plant species and is known for its potential biological activities, including antioxidant and anti-inflammatory properties. Neoschaftoside typically exhibits a yellow to brown color and is soluble in polar solvents, which is characteristic of many flavonoid glycosides. Its structure features a flavonoid backbone linked to a sugar moiety, which contributes to its solubility and biological activity. Research has indicated that compounds like neoschaftoside may have applications in pharmacology, particularly in traditional medicine, due to their potential health benefits. However, detailed studies on its pharmacokinetics, toxicity, and specific therapeutic effects are still ongoing. As with many natural products, the extraction and purification processes can influence its characteristics and efficacy.
Formula:C26H28O14
InChI:InChI=1S/C26H28O14/c27-6-13-18(32)21(35)23(37)26(40-13)15-19(33)14-10(29)5-12(8-1-3-9(28)4-2-8)39-24(14)16(20(15)34)25-22(36)17(31)11(30)7-38-25/h1-5,11,13,17-18,21-23,25-28,30-37H,6-7H2/t11-,13+,17-,18+,21-,22+,23+,25+,26-/m0/s1
InChI key:InChIKey=MMDUKUSNQNWVET-LQYCTPBQSA-N
SMILES:OC=1C(=C2C(=C(O)C1[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)C(=O)C=C(O2)C4=CC=C(O)C=C4)[C@@H]5[C@H](O)[C@@H](O)[C@@H](O)CO5
Synonyms:- 4H-1-Benzopyran-4-one, 8-β-<span class="text-smallcaps">L</smallcap>-arabinopyranosyl-6-β-<smallcap>D</span>-glucopyranosyl-5,7-dihydroxy-2-(4-hydroxyphenyl)-
- 8-β-<span class="text-smallcaps">L</smallcap>-Arabinopyranosyl-6-β-<smallcap>D</span>-glucopyranosyl-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one
- Neoschaftoside
- neo-Schaftoside
- 4H-1-Benzopyran-4-one, 8-β-L-arabinopyranosyl-6-β-D-glucopyranosyl-5,7-dihydroxy-2-(4-hydroxyphenyl)-
- 8-β-L-Arabinopyranosyl-6-β-D-glucopyranosyl-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Neoschaftoside
CAS:Neoschaftoside has antioxidant activity.Formula:C26H28O14Purity:98%Color and Shape:SolidMolecular weight:564.49Neoschaftoside
CAS:Neoschaftoside is a naturally occurring bioactive compound, which is an acylated flavonoid C-glycoside. It is primarily sourced from various plant species, including members of the Poaceae and Fabaceae families. The compound functions through its antioxidant and anti-inflammatory properties, interacting with cellular pathways to mitigate oxidative stress and modulate immune responses. These actions make neoschaftoside a compound of interest in pharmacological research, particularly in the study of chronic diseases where inflammation and oxidative damage are key pathological features. Its applications extend to potential therapeutic development in areas such as cardiovascular health, neuroprotection, and metabolic disorders. The ongoing investigation into its modes of action and bioavailability continues to reveal insights into its efficacy and potential as a natural therapeutic agent.Formula:C26H28O14Purity:Min. 95%Molecular weight:564.49 g/mol


