CAS 61330-61-8
:2,3,4,6-tetra-O-benzyl-D-mannopyranose
Description:
2,3,4,6-Tetra-O-benzyl-D-mannopyranose is a glycoside derivative of D-mannose, characterized by the presence of four benzyl groups attached to the hydroxyl positions at carbons 2, 3, 4, and 6 of the mannopyranose ring. This compound is typically a white to off-white solid, exhibiting good solubility in organic solvents such as dichloromethane and dimethyl sulfoxide, but limited solubility in water due to its hydrophobic benzyl groups. The presence of these benzyl groups enhances the compound's stability and lipophilicity, making it useful in various organic synthesis applications, particularly in carbohydrate chemistry. It can serve as a protecting group in the synthesis of more complex carbohydrates or glycosides. Additionally, 2,3,4,6-tetra-O-benzyl-D-mannopyranose can be utilized in studies related to glycosylation reactions and the development of glycosyl donors. Its structure can be confirmed through techniques such as NMR spectroscopy and mass spectrometry, which provide insights into its molecular configuration and purity.
Formula:C34H36O6
InChI:InChI=1/C34H36O6/c35-34-33(39-24-29-19-11-4-12-20-29)32(38-23-28-17-9-3-10-18-28)31(37-22-27-15-7-2-8-16-27)30(40-34)25-36-21-26-13-5-1-6-14-26/h1-20,30-35H,21-25H2/t30-,31-,32+,33+,34+/m1/s1
Synonyms:- 2,3,4,6-tetra-O-benzyl-alpha-D-mannopyranose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
D-Mannose, 2,3,4,6-tetrakis-O-(phenylmethyl)-
CAS:Formula:C34H36O6Purity:97%Color and Shape:LiquidMolecular weight:540.64603,4,5-Tris(Benzyloxy)-6-((Benzyloxy)Methyl)Tetrahydro-2h-Pyran-2-Ol
CAS:3,4,5-Tris(Benzyloxy)-6-((Benzyloxy)Methyl)Tetrahydro-2h-Pyran-2-OlPurity:97%Molecular weight:540.65g/mol2,3,4,6-Tetra-O-benzyl-D-mannopyranose
CAS:Formula:C34H36O6Purity:≥ 95.0%Color and Shape:Colourless to light yellow oilMolecular weight:540.72,3,4,6-Tetra-O-benzyl-D-mannopyranose
CAS:2,3,4,6-Tetra-O-benzyl-D-mannopyranose is a trisaccharide that consists of two covalently linked glycosyl acceptors and one galacto moiety. This molecule is synthesized by chemoenzymatic synthesis and can be found in the biosynthesis of trehalose. 2,3,4,6-Tetra-O-benzyl-D-mannopyranose is an anomeric form of D-glucopyranose. The anomeric form is determined by the orientation of the hydroxyl group at C1' with respect to the anomeric carbon atom at C2'. This molecule has been isotopically labelled with 13C and 15N for use in studies on carbohydrate metabolism.Formula:C34H36O6Purity:90%Color and Shape:Yellow PowderMolecular weight:540.65 g/mol2,3,4,6-Tetra-O-benzyl-D-mannopyranose
CAS:Controlled ProductApplications 2,3,4,6-Tetra-O-benzyl-D-mannopyranose (cas# 61330-61-8) is a compound useful in organic synthesis.
References Furukawa, H., et al.: Chem. Pharm. Bull., 46, 1244 (1998), Kaila, N., et al.: Bioorg. Med. Chem. Lett., 11, 151 (2001), Sugimura, H., et al.: Nucleosides, Nucleotides & Nucleic Acids, 22, 727 (2003),Formula:C34H36O6Color and Shape:NeatMolecular weight:540.65




