CAS 61330-62-9
:(3R,4S,5R,6S)-3,4,5-tribenzyloxy-2-(benzyloxymethyl)-6-methoxy-tetrahydropyran
Description:
The chemical substance known as (3R,4S,5R,6S)-3,4,5-tribenzyloxy-2-(benzyloxymethyl)-6-methoxy-tetrahydropyran, with the CAS number 61330-62-9, is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features multiple benzyloxy substituents, indicating the presence of benzyl groups attached to oxygen atoms, which contribute to its reactivity and solubility properties. The stereochemistry of the molecule is defined by the specific configuration at the chiral centers, denoted by the (3R,4S,5R,6S) notation, which influences its biological activity and interaction with other molecules. The methoxy group further enhances its chemical properties, potentially affecting its polarity and reactivity. Such compounds are often of interest in synthetic organic chemistry and medicinal chemistry due to their potential applications in drug development and as intermediates in the synthesis of more complex molecules. The presence of multiple aromatic and ether functionalities suggests that it may exhibit interesting physical and chemical properties, including solubility in organic solvents and potential interactions with biological targets.
Formula:C35H38O6
InChI:InChI=1/C35H38O6/c1-36-35-34(40-25-30-20-12-5-13-21-30)33(39-24-29-18-10-4-11-19-29)32(38-23-28-16-8-3-9-17-28)31(41-35)26-37-22-27-14-6-2-7-15-27/h2-21,31-35H,22-26H2,1H3/t31?,32-,33+,34-,35+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl 2,3,4,6-tetra-O-benzyl-α-D-mannopyranoside
CAS:Methyl 2,3,4,6-tetra-O-benzyl-α-D-mannopyranosideColor and Shape:LiquidMolecular weight:554.67g/molMethyl 2,3,4,6-Tetra-O-benzyl-α-D-mannopyranoside
CAS:Controlled ProductFormula:C35H38O6Color and Shape:NeatMolecular weight:554.67Methyl 2,3,4,6-tetra-O-benzyl-a-D-mannopyranoside
CAS:<p>Methyl 2,3,4,6-tetra-O-benzyl-a-D-mannopyranoside is a glycosylation product that can be used in chemical synthesis. This compound is an example of a complex carbohydrate and can be modified with methyl or fluorine groups. Methyl 2,3,4,6-tetra-O-benzyl-a-D-mannopyranoside is also a sugar and an oligosaccharide. This compound has been custom synthesized to meet customer specifications and is available in high purity.</p>Formula:C35H38O6Purity:Min. 95%Color and Shape:Clear Viscous LiquidMolecular weight:554.67 g/mol




