CAS 61337-67-5
:Mirtazapine
Description:
Mirtazapine is an antidepressant medication primarily used to treat major depressive disorder. It belongs to the class of noradrenergic and specific serotonergic antidepressants (NaSSAs). The chemical formula for mirtazapine is C17H19N3, and it features a tetracyclic structure that includes a phenyl ring and a piperazine moiety. Mirtazapine acts by antagonizing certain serotonin receptors (5-HT2 and 5-HT3) and enhancing norepinephrine release, which contributes to its antidepressant effects. It is known for its sedative properties, often leading to increased appetite and weight gain in some patients. Mirtazapine is typically administered orally and has a relatively long half-life, allowing for once-daily dosing. Common side effects may include drowsiness, dry mouth, and increased cholesterol levels. Due to its pharmacological profile, mirtazapine is sometimes preferred for patients who experience insomnia or significant weight loss associated with depression. As with any medication, it is essential for patients to consult healthcare professionals for personalized advice and monitoring.
Formula:C17H19N3
InChI:InChI=1S/C17H19N3/c1-19-9-10-20-16(12-19)15-7-3-2-5-13(15)11-14-6-4-8-18-17(14)20/h2-8,16H,9-12H2,1H3
InChI key:InChIKey=RONZAEMNMFQXRA-UHFFFAOYSA-N
SMILES:CN1CC2N(C=3C(CC=4C2=CC=CC4)=CC=CN3)CC1
Synonyms:- 6-Azamianserin
- Org 3770
- Pyrazino[2,1-a]pyrido[2,3-c][2]benzazepine, 1,2,3,4,10,14b-hexahydro-2-methyl-, (±)-
- 1,2,3,4,10,14b-Hexahydro-2-methylpyrazino[2,1-a]pyrido[2,3-c][2]benzazepine
- Pyrazino[2,1-a]pyrido[2,3-c][2]benzazepine, 1,2,3,4,10,14b-hexahydro-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
